diff options
Diffstat (limited to 'plugins/Clist_ng/coolsb')
-rw-r--r-- | plugins/Clist_ng/coolsb/coolsb.dsp | 92 | ||||
-rw-r--r-- | plugins/Clist_ng/coolsb/coolsb.plg | 31 | ||||
-rw-r--r-- | plugins/Clist_ng/coolsb/coolsb_internal.h | 95 | ||||
-rw-r--r-- | plugins/Clist_ng/coolsb/coolsblib.cpp | 1002 | ||||
-rw-r--r-- | plugins/Clist_ng/coolsb/coolsblib.h | 41 | ||||
-rw-r--r-- | plugins/Clist_ng/coolsb/coolscroll.cpp | 3214 | ||||
-rw-r--r-- | plugins/Clist_ng/coolsb/coolscroll.h | 232 | ||||
-rw-r--r-- | plugins/Clist_ng/coolsb/userdefs.h | 79 |
8 files changed, 4786 insertions, 0 deletions
diff --git a/plugins/Clist_ng/coolsb/coolsb.dsp b/plugins/Clist_ng/coolsb/coolsb.dsp new file mode 100644 index 0000000000..34e7a537a1 --- /dev/null +++ b/plugins/Clist_ng/coolsb/coolsb.dsp @@ -0,0 +1,92 @@ +# Microsoft Developer Studio Project File - Name="coolsb" - Package Owner=<4>
+# Microsoft Developer Studio Generated Build File, Format Version 6.00
+# ** NICHT BEARBEITEN **
+
+# TARGTYPE "Win32 (x86) Static Library" 0x0104
+
+CFG=coolsb - Win32 Debug
+!MESSAGE Dies ist kein gültiges Makefile. Zum Erstellen dieses Projekts mit NMAKE
+!MESSAGE verwenden Sie den Befehl "Makefile exportieren" und führen Sie den Befehl
+!MESSAGE
+!MESSAGE NMAKE /f "coolsb.mak".
+!MESSAGE
+!MESSAGE Sie können beim Ausführen von NMAKE eine Konfiguration angeben
+!MESSAGE durch Definieren des Makros CFG in der Befehlszeile. Zum Beispiel:
+!MESSAGE
+!MESSAGE NMAKE /f "coolsb.mak" CFG="coolsb - Win32 Debug"
+!MESSAGE
+!MESSAGE Für die Konfiguration stehen zur Auswahl:
+!MESSAGE
+!MESSAGE "coolsb - Win32 Release" (basierend auf "Win32 (x86) Static Library")
+!MESSAGE "coolsb - Win32 Debug" (basierend auf "Win32 (x86) Static Library")
+!MESSAGE
+
+# Begin Project
+# PROP AllowPerConfigDependencies 0
+# PROP Scc_ProjName ""
+# PROP Scc_LocalPath ""
+CPP=cl.exe
+RSC=rc.exe
+
+!IF "$(CFG)" == "coolsb - Win32 Release"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir "Release"
+# PROP BASE Intermediate_Dir "Release"
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir "Release"
+# PROP Intermediate_Dir "Release"
+# PROP Target_Dir ""
+# ADD BASE CPP /nologo /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_MBCS" /D "_LIB" /YX /FD /c
+# ADD CPP /nologo /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_MBCS" /D "_LIB" /YX /FD /c
+# ADD BASE RSC /l 0x809 /d "NDEBUG"
+# ADD RSC /l 0x809 /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LIB32=link.exe -lib
+# ADD BASE LIB32 /nologo
+# ADD LIB32 /nologo
+
+!ELSEIF "$(CFG)" == "coolsb - Win32 Debug"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 1
+# PROP BASE Output_Dir "Debug"
+# PROP BASE Intermediate_Dir "Debug"
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 1
+# PROP Output_Dir "Debug"
+# PROP Intermediate_Dir "Debug"
+# PROP Target_Dir ""
+# ADD BASE CPP /nologo /W3 /Gm /GX /ZI /Od /D "WIN32" /D "_DEBUG" /D "_MBCS" /D "_LIB" /YX /FD /GZ /c
+# ADD CPP /nologo /W3 /Gm /GX /ZI /Od /D "WIN32" /D "_DEBUG" /D "_MBCS" /D "_LIB" /YX /FD /GZ /c
+# ADD BASE RSC /l 0x809 /d "_DEBUG"
+# ADD RSC /l 0x809 /d "_DEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LIB32=link.exe -lib
+# ADD BASE LIB32 /nologo
+# ADD LIB32 /nologo
+
+!ENDIF
+
+# Begin Target
+
+# Name "coolsb - Win32 Release"
+# Name "coolsb - Win32 Debug"
+# Begin Group "Source Files"
+
+# PROP Default_Filter "cpp;c;cxx;rc;def;r;odl;idl;hpj;bat"
+# End Group
+# Begin Group "Header Files"
+
+# PROP Default_Filter "h;hpp;hxx;hm;inl"
+# End Group
+# End Target
+# End Project
diff --git a/plugins/Clist_ng/coolsb/coolsb.plg b/plugins/Clist_ng/coolsb/coolsb.plg new file mode 100644 index 0000000000..823664af18 --- /dev/null +++ b/plugins/Clist_ng/coolsb/coolsb.plg @@ -0,0 +1,31 @@ +<html>
+<body>
+<pre>
+<h1>Erstellungsprotokoll</h1>
+<h3>
+--------------------Konfiguration: coolsb - Win32 Debug--------------------
+</h3>
+<h3>Befehlszeilen</h3>
+Erstellen der temporären Datei "c:\temp\RSPCFBF.tmp" mit Inhalten
+[
+/nologo /MLd /W3 /Gm /GX /ZI /Od /D "WIN32" /D "_DEBUG" /D "_MBCS" /D "_LIB" /Fp"Debug/coolsb.pch" /YX /Fo"Debug/" /Fd"Debug/" /FD /GZ /c
+"C:\tabsrmm\trunk\miranda\plugins\clist_nicer\coolsb\coolscroll.cpp"
+"C:\tabsrmm\trunk\miranda\plugins\clist_nicer\coolsb\coolsblib.cpp"
+]
+Creating command line "cl.exe @c:\temp\RSPCFBF.tmp"
+Erstellen der Befehlzeile "link.exe -lib /nologo /out:"Debug\coolsb.lib" .\Debug\coolscroll.obj .\Debug\coolsblib.obj "
+<h3>Ausgabefenster</h3>
+Kompilierung läuft...
+coolscroll.cpp
+c:\tabsrmm\trunk\miranda\plugins\clist_nicer\coolsb\coolscroll.cpp(49) : fatal error C1083: Include-Datei kann nicht geöffnet werden: 'commonheaders.h': No such file or directory
+coolsblib.cpp
+c:\tabsrmm\trunk\miranda\plugins\clist_nicer\coolsb\coolsblib.cpp(32) : fatal error C1083: Include-Datei kann nicht geöffnet werden: 'commonheaders.h': No such file or directory
+Fehler beim Ausführen von cl.exe.
+
+
+
+<h3>Ergebnisse</h3>
+coolsb.lib - 2 Fehler, 0 Warnung(en)
+</pre>
+</body>
+</html>
diff --git a/plugins/Clist_ng/coolsb/coolsb_internal.h b/plugins/Clist_ng/coolsb/coolsb_internal.h new file mode 100644 index 0000000000..8a394f8a51 --- /dev/null +++ b/plugins/Clist_ng/coolsb/coolsb_internal.h @@ -0,0 +1,95 @@ +#ifndef _COOLSB_INTERNAL_INCLUDED
+#define _COOLSB_INTERNAL_INCLUDED
+
+#ifdef __cplusplus
+extern "C"{
+#endif
+
+#include <windows.h>
+
+//
+// SCROLLBAR datatype. There are two of these structures per window
+//
+typedef struct
+{
+ UINT fScrollFlags; //flags
+ BOOL fScrollVisible; //if this scrollbar visible?
+ SCROLLINFO scrollInfo; //positional data (range, position, page size etc)
+
+ int nArrowLength; //perpendicular size (height of a horizontal, width of a vertical)
+ int nArrowWidth; //parallel size (width of horz, height of vert)
+
+ //data for inserted buttons
+ SCROLLBUT sbButtons[MAX_COOLSB_BUTS];
+ int nButtons;
+ int nButSizeBefore; //size to the left / above the bar
+ int nButSizeAfter; //size to the right / below the bar
+
+ BOOL fButVisibleBefore; //if the buttons to the left are visible
+ BOOL fButVisibleAfter; //if the buttons to the right are visible
+
+ int nBarType; //SB_HORZ / SB_VERT
+
+ UINT fFlatScrollbar; //do we display flat scrollbars?
+ int nMinThumbSize;
+
+} SCROLLBAR;
+
+//
+// Container structure for a cool scrollbar window.
+//
+typedef struct
+{
+ UINT bars; //which of the scrollbars do we handle? SB_VERT / SB_HORZ / SB_BOTH
+ WNDPROC oldproc; //old window procedure to call for every message
+
+ SCROLLBAR sbarHorz; //one scrollbar structure each for
+ SCROLLBAR sbarVert; //the horizontal and vertical scrollbars
+
+ BOOL fThumbTracking; // are we currently thumb-tracking??
+ BOOL fLeftScrollbar; // support the WS_EX_LEFTSCROLLBAR style
+
+ HWND hwndToolTip; // tooltip support!!!
+
+ //size of the window borders
+ int cxLeftEdge, cxRightEdge;
+ int cyTopEdge, cyBottomEdge;
+
+ // To prevent calling original WindowProc in response
+ // to our own temporary style change (fixes TreeView problem)
+ BOOL bPreventStyleChange;
+
+} SCROLLWND;
+
+
+//
+// PRIVATE INTERNAL FUNCTIONS
+//
+SCROLLWND *GetScrollWndFromHwnd(HWND hwnd);
+#define InvertCOLORREF(col) ((~col) & 0x00ffffff)
+
+#define COOLSB_TIMERID1 65533 //initial timer
+#define COOLSB_TIMERID2 65534 //scroll message timer
+#define COOLSB_TIMERID3 -14 //mouse hover timer
+#define COOLSB_TIMERINTERVAL1 300
+#define COOLSB_TIMERINTERVAL2 55
+#define COOLSB_TIMERINTERVAL3 20 //mouse hover time
+
+
+//
+// direction: 0 - same axis as scrollbar (i.e. width of a horizontal bar)
+// 1 - perpendicular dimesion (i.e. height of a horizontal bar)
+//
+#define SM_CXVERTSB 1
+#define SM_CYVERTSB 0
+#define SM_CXHORZSB 0
+#define SM_CYHORZSB 1
+#define SM_SCROLL_WIDTH 1
+#define SM_SCROLL_LENGTH 0
+
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif
diff --git a/plugins/Clist_ng/coolsb/coolsblib.cpp b/plugins/Clist_ng/coolsb/coolsblib.cpp new file mode 100644 index 0000000000..e5da7f7605 --- /dev/null +++ b/plugins/Clist_ng/coolsb/coolsblib.cpp @@ -0,0 +1,1002 @@ +/*
+
+ Cool Scrollbar Library Version 1.2
+
+ Module: coolsblib.c
+ Copyright (c) J Brown 2001
+
+ This code is freeware, however, you may not publish
+ this code elsewhere or charge any money for it. This code
+ is supplied as-is. I make no guarantees about the suitability
+ of this code - use at your own risk.
+
+ It would be nice if you credited me, in the event
+ that you use this code in a product.
+
+ VERSION HISTORY:
+
+ V1.2: TreeView problem fixed by Diego Tartara
+ Small problem in thumbsize calculation also fixed (thanks Diego!)
+
+ V1.1: Added support for Right-left windows
+ Changed calling convention of APIs to WINAPI (__stdcall)
+ Completely standalone (no need for c-runtime)
+
+ V1.0: Apr 2001: Initial Version
+
+*/
+
+#define _WIN32_WINNT 0x0502
+#define _WIN32_IE 0x0501
+
+#include <commonheaders.h>
+#include "coolscroll.h"
+#include "userdefs.h"
+#include "coolsb_internal.h"
+
+static wchar_t szPropStr[] = _T("CoolSBSubclassPtr");
+
+LRESULT CALLBACK CoolSBWndProc(HWND hwnd, UINT message, WPARAM wParam, LPARAM lParam);
+
+SCROLLWND *GetScrollWndFromHwnd(HWND hwnd)
+{
+ return (SCROLLWND *)GetProp(hwnd, szPropStr);
+}
+
+SCROLLBAR *GetScrollBarFromHwnd(HWND hwnd, UINT nBar)
+{
+ SCROLLWND *sw = GetScrollWndFromHwnd(hwnd);
+
+ if(!sw) return 0;
+
+ if(nBar == SB_HORZ)
+ return &sw->sbarHorz;
+ else if(nBar == SB_VERT)
+ return &sw->sbarVert;
+ else
+ return 0;
+}
+
+BOOL WINAPI CoolSB_IsCoolScrollEnabled(HWND hwnd)
+{
+ if(GetScrollWndFromHwnd(hwnd))
+ return TRUE;
+ else
+ return FALSE;
+}
+
+BOOL GetScrollRect(SCROLLWND *sw, UINT nBar, HWND hwnd, RECT *rect);
+
+//
+// Special support for USER32.DLL patching (using Detours library)
+// The only place we call a real scrollbar API is in InitializeCoolSB,
+// where we call EnableScrollbar.
+//
+// We HAVE to call the origial EnableScrollbar function,
+// so we need to be able to set a pointer to this func when using
+// using Detours (or any other LIB??)
+//
+
+typedef BOOL (WINAPI *WPROC)(HWND, UINT, UINT);
+
+static WPROC pEnableScrollBar = 0;
+
+void WINAPI CoolSB_SetESBProc(WPROC proc)
+{
+ pEnableScrollBar = proc;
+}
+//
+//
+
+static void RedrawNonClient(HWND hwnd, BOOL fFrameChanged)
+{
+ if(fFrameChanged == FALSE)
+ {
+ /*
+ RECT rect;
+ HRGN hrgn1, hrgn2;
+
+ SCROLLWND *sw = GetScrollWndFromHwnd(hwnd);
+
+ GetScrollRect(sw, SB_HORZ, hwnd, &rect);
+ hrgn1 = CreateRectRgnIndirect(&rect);
+
+ GetScrollRect(sw, SB_VERT, hwnd, &rect);
+ hrgn2 = CreateRectRgnIndirect(&rect);
+
+ CombineRgn(hrgn1, hrgn2, hrgn1, RGN_OR);
+
+ SendMessage(hwnd, WM_NCPAINT, (WPARAM)hrgn1, 0);
+
+ DeleteObject(hrgn1);
+ DeleteObject(hrgn2);*/
+
+ SendMessage(hwnd, WM_NCPAINT, (WPARAM)1, 0);
+ }
+ else
+ {
+ SetWindowPos(hwnd, 0, 0, 0, 0, 0, SWP_NOMOVE | SWP_NOSIZE | SWP_NOZORDER | SWP_NOACTIVATE
+ | SWP_FRAMECHANGED | SWP_DRAWFRAME);
+ }
+}
+
+//
+// return the default minimum size of a scrollbar thumb
+//
+int WINAPI CoolSB_GetDefaultMinThumbSize(void)
+{
+ DWORD dwVersion = GetVersion();
+
+ // set the minimum thumb size for a scrollbar. This
+ // differs between NT4 and 2000, so need to check to see
+ // which platform we are running under
+ if(dwVersion < 0x80000000) // Windows NT/2000
+ {
+ if(LOBYTE(LOWORD(dwVersion)) >= 5)
+ return MINTHUMBSIZE_2000;
+ else
+ return MINTHUMBSIZE_NT4;
+ }
+ else
+ {
+ return MINTHUMBSIZE_NT4;
+ }
+}
+
+static SCROLLINFO *GetScrollInfoFromHwnd(HWND hwnd, int fnBar)
+{
+ SCROLLBAR *sb = GetScrollBarFromHwnd(hwnd, fnBar);
+
+ if(sb == 0)
+ return FALSE;
+
+ if(fnBar == SB_HORZ)
+ {
+ return &sb->scrollInfo;
+ }
+ else if(fnBar == SB_VERT)
+ {
+ return &sb->scrollInfo;
+ }
+ else
+ return NULL;
+}
+//
+// Initialize the cool scrollbars for a window by subclassing it
+// and using the coolsb window procedure instead
+//
+BOOL WINAPI InitializeCoolSB(HWND hwnd)
+{
+ SCROLLWND *sw;
+ SCROLLINFO *si;
+ INITCOMMONCONTROLSEX ice;
+ TOOLINFO ti;
+ RECT rect;
+ DWORD dwCurStyle;
+ //BOOL fDisabled;
+
+ if(pEnableScrollBar == 0)
+ pEnableScrollBar = EnableScrollBar;
+
+ GetClientRect(hwnd, &rect);
+
+ //if we have already initialized Cool Scrollbars for this window,
+ //then stop the user from doing it again
+ if(GetScrollWndFromHwnd(hwnd) != 0)
+ {
+ return FALSE;
+ }
+
+ //allocate a private scrollbar structure which we
+ //will use to keep track of the scrollbar data
+ sw = (SCROLLWND *)HeapAlloc(GetProcessHeap(), HEAP_ZERO_MEMORY, sizeof(SCROLLWND));
+
+ si = &sw->sbarHorz.scrollInfo;
+ si->cbSize = sizeof(SCROLLINFO);
+ si->fMask = SIF_ALL;
+ GetScrollInfo(hwnd, SB_HORZ, si);
+
+ si = &sw->sbarVert.scrollInfo;
+ si->cbSize = sizeof(SCROLLINFO);
+ si->fMask = SIF_ALL;
+ GetScrollInfo(hwnd, SB_VERT, si);
+
+ //check to see if the window has left-aligned scrollbars
+ if(GetWindowLong(hwnd, GWL_EXSTYLE) & WS_EX_LEFTSCROLLBAR)
+ sw->fLeftScrollbar = TRUE;
+ else
+ sw->fLeftScrollbar = FALSE;
+
+ dwCurStyle = GetWindowLong(hwnd, GWL_STYLE);
+
+ SetProp(hwnd, szPropStr, (HANDLE)sw);
+
+ //try to enable the scrollbar arrows - if the return value is
+ //non-zero, then the scrollbars were previously disabled
+ //fDisabled = pEnableScrollBar(hwnd, SB_HORZ, ESB_ENABLE_BOTH);
+
+ //scrollbars will automatically get enabled, even if
+ //they aren't to start with....sorry, but there isn't an
+ //easy alternative.
+ if(dwCurStyle & WS_HSCROLL)
+ sw->sbarHorz.fScrollFlags = CSBS_VISIBLE;
+
+ if(dwCurStyle & WS_VSCROLL)
+ sw->sbarVert.fScrollFlags = CSBS_VISIBLE;
+
+ //need to be able to distinguish between horizontal and vertical
+ //scrollbars in some instances
+ sw->sbarHorz.nBarType = SB_HORZ;
+ sw->sbarVert.nBarType = SB_VERT;
+
+ sw->sbarHorz.fFlatScrollbar = CSBS_NORMAL;
+ sw->sbarVert.fFlatScrollbar = CSBS_NORMAL;
+
+ //set the default arrow sizes for the scrollbars
+ sw->sbarHorz.nArrowLength = SYSTEM_METRIC;
+ sw->sbarHorz.nArrowWidth = SYSTEM_METRIC;
+ sw->sbarVert.nArrowLength = SYSTEM_METRIC;
+ sw->sbarVert.nArrowWidth = SYSTEM_METRIC;
+
+ sw->bPreventStyleChange = FALSE;
+
+ sw->oldproc = (WNDPROC)SetWindowLongPtr(hwnd, GWLP_WNDPROC, (LONG_PTR)CoolSBWndProc);
+
+ CoolSB_SetMinThumbSize(hwnd, SB_BOTH, CoolSB_GetDefaultMinThumbSize());
+
+#ifdef COOLSB_TOOLTIPS
+ ice.dwSize = sizeof(ice);
+ ice.dwICC = ICC_BAR_CLASSES;
+ InitCommonControlsEx(&ice);
+
+ sw->hwndToolTip = CreateWindowEx(WS_EX_TOPMOST | WS_EX_TOOLWINDOW, TOOLTIPS_CLASS, _T(""),
+ WS_POPUP | TTS_NOPREFIX | TTS_ALWAYSTIP,
+ CW_USEDEFAULT, CW_USEDEFAULT,
+ CW_USEDEFAULT, CW_USEDEFAULT,
+ hwnd, NULL, GetModuleHandle(0),
+ NULL);
+
+ ti.cbSize = sizeof(TOOLINFO);
+ ti.uFlags = TTF_IDISHWND;
+ ti.hwnd = hwnd;
+ ti.uId = (UINT)hwnd;
+ ti.lpszText = LPSTR_TEXTCALLBACK;
+ ti.hinst = GetModuleHandle(0);
+
+ SendMessage(sw->hwndToolTip, TTM_ADDTOOL, 0, (LPARAM)&ti);
+
+#else
+
+ UNREFERENCED_PARAMETER(ice);
+ UNREFERENCED_PARAMETER(ti);
+ sw->hwndToolTip = 0;
+
+#endif
+
+ //send the window a frame changed message to update the scrollbars
+ RedrawNonClient(hwnd, TRUE);
+
+ return TRUE;
+}
+
+BOOL WINAPI CoolSB_EnableScrollBar (HWND hwnd, int wSBflags, UINT wArrows)
+{
+ SCROLLBAR *sbar;
+ UINT oldstate;
+ BOOL bFailed = FALSE;
+
+ if(!CoolSB_IsCoolScrollEnabled(hwnd))
+ return EnableScrollBar(hwnd, wSBflags, wArrows);
+
+ if((wSBflags == SB_HORZ || wSBflags == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_HORZ)))
+ {
+ oldstate = sbar->fScrollFlags;
+
+ //clear any existing state, and OR in the disabled flags
+ sbar->fScrollFlags = (sbar->fScrollFlags & ~ESB_DISABLE_BOTH) | wArrows;
+
+ if(oldstate == sbar->fScrollFlags)
+ bFailed = TRUE;
+
+ }
+
+ if((wSBflags == SB_VERT || wSBflags == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_VERT)))
+ {
+ oldstate = sbar->fScrollFlags;
+
+ //clear any existing state, and OR in the disabled flags
+ sbar->fScrollFlags = (sbar->fScrollFlags & ~ESB_DISABLE_BOTH) | wArrows;
+
+ if(oldstate == sbar->fScrollFlags)
+ bFailed = TRUE;
+ }
+
+ return !bFailed;
+}
+
+BOOL WINAPI CoolSB_GetScrollBarInfo(HWND hwnd)
+{
+// SCROLLBARINFO sbi; not defined in winuser.h
+ return FALSE;
+}
+
+BOOL WINAPI CoolSB_GetScrollInfo (HWND hwnd, int fnBar, LPSCROLLINFO lpsi)
+{
+ SCROLLINFO *mysi;
+ BOOL copied = FALSE;
+
+ if(!lpsi)
+ return FALSE;
+
+ if(!(mysi = GetScrollInfoFromHwnd(hwnd, fnBar)))
+ {
+ return GetScrollInfo(hwnd, fnBar, lpsi);
+ }
+
+ if(lpsi->fMask & SIF_PAGE)
+ {
+ lpsi->nPage = mysi->nPage;
+ copied = TRUE;
+ }
+
+ if(lpsi->fMask & SIF_POS)
+ {
+ lpsi->nPos = mysi->nPos;
+ copied = TRUE;
+ }
+
+ if(lpsi->fMask & SIF_TRACKPOS)
+ {
+ lpsi->nTrackPos = mysi->nTrackPos;
+ copied = TRUE;
+ }
+
+ if(lpsi->fMask & SIF_RANGE)
+ {
+ lpsi->nMin = mysi->nMin;
+ lpsi->nMax = mysi->nMax;
+ copied = TRUE;
+ }
+
+ return copied;
+}
+
+int WINAPI CoolSB_GetScrollPos (HWND hwnd, int nBar)
+{
+ SCROLLINFO *mysi;
+
+ if(!(mysi = GetScrollInfoFromHwnd(hwnd, nBar)))
+ return GetScrollPos(hwnd, nBar);
+
+ return mysi->nPos;
+}
+
+BOOL WINAPI CoolSB_GetScrollRange (HWND hwnd, int nBar, LPINT lpMinPos, LPINT lpMaxPos)
+{
+ SCROLLINFO *mysi;
+
+ if(!lpMinPos || !lpMaxPos)
+ return FALSE;
+
+ if(!(mysi = GetScrollInfoFromHwnd(hwnd, nBar)))
+ return GetScrollRange(hwnd, nBar, lpMinPos, lpMaxPos);
+
+ *lpMinPos = mysi->nMin;
+ *lpMaxPos = mysi->nMax;
+
+ return TRUE;
+}
+
+int WINAPI CoolSB_SetScrollInfo (HWND hwnd, int fnBar, LPSCROLLINFO lpsi, BOOL fRedraw)
+{
+ SCROLLINFO *mysi;
+ SCROLLBAR *sbar;
+ BOOL fRecalcFrame = FALSE;
+
+ if(!lpsi)
+ return FALSE;
+
+ if(!(mysi = GetScrollInfoFromHwnd(hwnd, fnBar)))
+ return SetScrollInfo(hwnd, fnBar, lpsi, fRedraw);
+
+ //if(CoolSB_IsThumbTracking(hwnd))
+ // return mysi->nPos;
+
+ if(lpsi->fMask & SIF_RANGE)
+ {
+ mysi->nMin = lpsi->nMin;
+ mysi->nMax = lpsi->nMax;
+ }
+
+ //The nPage member must specify a value from 0 to nMax - nMin +1.
+ if(lpsi->fMask & SIF_PAGE)
+ {
+ UINT t = (UINT)(mysi->nMax - mysi->nMin + 1);
+ mysi->nPage = min(max(0, lpsi->nPage), t);
+ }
+
+ //The nPos member must specify a value between nMin and nMax - max(nPage - 1, 0).
+ if(lpsi->fMask & SIF_POS)
+ {
+ mysi->nPos = max(lpsi->nPos, mysi->nMin);
+ mysi->nPos = min((UINT)mysi->nPos, mysi->nMax - max(mysi->nPage - 1, 0));
+ }
+
+ sbar = GetScrollBarFromHwnd(hwnd, fnBar);
+
+ if((lpsi->fMask & SIF_DISABLENOSCROLL) || (sbar->fScrollFlags & CSBS_THUMBALWAYS))
+ {
+ if(!sbar->fScrollVisible)
+ {
+ CoolSB_ShowScrollBar(hwnd, fnBar, TRUE);
+ fRecalcFrame = TRUE;
+ }
+ }
+ else
+ {
+ if( mysi->nPage > (UINT)mysi->nMax
+ || mysi->nPage == (UINT)mysi->nMax && mysi->nMax == 0
+ || mysi->nMax <= mysi->nMin)
+ {
+ if(sbar->fScrollVisible)
+ {
+ CoolSB_ShowScrollBar(hwnd, fnBar, FALSE);
+ fRecalcFrame = TRUE;
+ }
+ }
+ else
+ {
+ if(!sbar->fScrollVisible)
+ {
+ CoolSB_ShowScrollBar(hwnd, fnBar, TRUE);
+ fRecalcFrame = TRUE;
+ }
+
+ }
+
+ }
+
+ if(fRedraw && !CoolSB_IsThumbTracking(hwnd))
+ RedrawNonClient(hwnd, fRecalcFrame);
+
+ return mysi->nPos;
+}
+
+
+int WINAPI CoolSB_SetScrollPos(HWND hwnd, int nBar, int nPos, BOOL fRedraw)
+{
+ SCROLLINFO *mysi;
+ int oldpos;
+
+ if(!(mysi = GetScrollInfoFromHwnd(hwnd, nBar)))
+ {
+ return SetScrollPos(hwnd, nBar, nPos, fRedraw);
+ }
+
+ //this is what should happen, but real scrollbars don't work like this..
+ //if(CoolSB_IsThumbTracking(hwnd))
+ // return mysi->nPos;
+
+ //validate and set the scollbar position
+ oldpos = mysi->nPos;
+ mysi->nPos = max(nPos, mysi->nMin);
+ mysi->nPos = min((UINT)mysi->nPos, mysi->nMax - max(mysi->nPage - 1, 0));
+
+ if(fRedraw && !CoolSB_IsThumbTracking(hwnd))
+ RedrawNonClient(hwnd, FALSE);
+
+ return oldpos;
+}
+
+int WINAPI CoolSB_SetScrollRange (HWND hwnd, int nBar, int nMinPos, int nMaxPos, BOOL fRedraw)
+{
+ SCROLLINFO *mysi;
+
+ if(!(mysi = GetScrollInfoFromHwnd(hwnd, nBar)))
+ return SetScrollRange(hwnd, nBar, nMinPos, nMaxPos, fRedraw);
+
+ if(CoolSB_IsThumbTracking(hwnd))
+ return mysi->nPos;
+
+ //hide the scrollbar if nMin == nMax
+ //nMax-nMin must not be greater than MAXLONG
+ mysi->nMin = nMinPos;
+ mysi->nMax = nMaxPos;
+
+ if(fRedraw)
+ RedrawNonClient(hwnd, FALSE);
+
+ return TRUE;
+}
+
+//
+// Show or hide the specified scrollbars
+//
+BOOL WINAPI CoolSB_ShowScrollBar (HWND hwnd, int wBar, BOOL fShow)
+{
+ SCROLLBAR *sbar;
+ BOOL bFailed = FALSE;
+ DWORD dwStyle = GetWindowLong(hwnd, GWL_STYLE);
+
+ if(!CoolSB_IsCoolScrollEnabled(hwnd))
+ return ShowScrollBar(hwnd, wBar, fShow);
+
+ if((wBar == SB_HORZ || wBar == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_HORZ)))
+ {
+ sbar->fScrollFlags = sbar->fScrollFlags & ~CSBS_VISIBLE;
+ sbar->fScrollFlags |= (fShow == TRUE ? CSBS_VISIBLE : 0);
+ //bFailed = TRUE;
+
+ if(fShow) SetWindowLong(hwnd, GWL_STYLE, dwStyle | WS_HSCROLL);
+ else SetWindowLong(hwnd, GWL_STYLE, dwStyle & ~WS_HSCROLL);
+ }
+
+ if((wBar == SB_VERT || wBar == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_VERT)))
+ {
+ sbar->fScrollFlags = sbar->fScrollFlags & ~CSBS_VISIBLE;
+ sbar->fScrollFlags |= (fShow == TRUE ? CSBS_VISIBLE : 0);
+ //bFailed = TRUE;
+
+ if(fShow) SetWindowLong(hwnd, GWL_STYLE, dwStyle | WS_VSCROLL);
+ else SetWindowLong(hwnd, GWL_STYLE, dwStyle & ~WS_VSCROLL);
+ }
+
+ if(bFailed)
+ {
+ return FALSE;
+ }
+ else
+ {
+ //DWORD style = GetWindowLong(hwnd, GWL_STYLE);
+ //style |= WS_VSCROLL;
+
+ //if(s
+ //SetWindowLong(hwnd, GWL_STYLE, style);
+
+ SetWindowPos(hwnd, 0, 0, 0, 0, 0,
+ SWP_NOMOVE | SWP_NOSIZE | SWP_NOZORDER |
+ SWP_NOACTIVATE | SWP_FRAMECHANGED);
+
+ return TRUE;
+ }
+}
+
+//
+// Remove cool scrollbars from the specified window.
+//
+HRESULT WINAPI UninitializeCoolSB(HWND hwnd)
+{
+ SCROLLWND *sw = GetScrollWndFromHwnd(hwnd);
+ if(!sw) return E_FAIL;
+
+ //restore the window procedure with the original one
+ SetWindowLongPtr(hwnd, GWLP_WNDPROC, (LONG_PTR)sw->oldproc);
+
+ RemoveProp(hwnd, szPropStr);
+ //SetWindowLongPtr(hwnd, GWLP_USERDATA, 0);
+
+ //finally, release the memory needed for the cool scrollbars
+ HeapFree(GetProcessHeap(), 0, sw);
+
+ //Force WM_NCCALCSIZE and WM_NCPAINT so the original scrollbars can kick in
+ RedrawNonClient(hwnd, TRUE);
+
+ return S_OK;
+}
+
+#ifdef INCLUDE_BUTTONS
+
+//
+// Cool scrollbar specific interface (BUTTON support)
+//
+
+//
+// Insert a button into the scrollbar area
+//
+// wSBflags - SB_HORZ / SB_VERT only
+// uPos - position into which to insert.
+// can be 0 to insert at the start, or -1 to insert
+// at the end of previously inserted buttons
+//
+
+BOOL WINAPI CoolSB_InsertButton(HWND hwnd, int wSBflags, UINT nPos, SCROLLBUT *psb)
+{
+ SCROLLBAR *sbar;
+ SCROLLBUT *sbut;
+ UINT i;
+
+ if(!psb) return FALSE;
+
+ if(!(sbar = GetScrollBarFromHwnd(hwnd, wSBflags)))
+ return FALSE;
+
+ //check that we havn't reached the maximum allowed buttons yet
+ if(sbar->nButtons == MAX_COOLSB_BUTS)
+ return FALSE;
+
+ //insert at end
+ if(nPos == -1)
+ {
+ sbut = &sbar->sbButtons[sbar->nButtons];
+ }
+ //otherwise, need to make room
+ else if((int)nPos < 0 || (int)nPos > (UINT)sbar->nButtons)
+ {
+ return FALSE;
+ }
+ else
+ {
+ //insert space for the button at the specified position
+ for(i = sbar->nButtons; i > nPos; i--)
+ {
+ sbar->sbButtons[i] = sbar->sbButtons[i-1];
+ }
+
+ sbut = &sbar->sbButtons[nPos];
+ }
+
+ //only set the button's properties if they are
+ //specified by the SCROLLBUT->fMask.
+ //Otherwise, use a default property value
+
+ if(psb->fMask & SBBF_TYPE)
+ sbut->uButType = psb->uButType;
+ else
+ sbut->uButType = SBBT_PUSHBUTTON;
+
+ if(psb->fMask & SBBF_STATE)
+ sbut->uState = psb->uState;
+ else
+ sbut->uState = 0;
+
+ if(psb->fMask & SBBF_ID)
+ sbut->uCmdId = psb->uCmdId;
+ else
+ sbut->uCmdId = 0;
+
+ if(psb->fMask & SBBF_SIZE)
+ sbut->nSize = psb->nSize;
+ else
+ sbut->nSize = -1;
+
+ if(psb->fMask & SBBF_PLACEMENT)
+ sbut->uPlacement = psb->uPlacement;
+ else
+ sbut->uPlacement = SBBP_LEFT;
+
+ if(psb->fMask & SBBF_BITMAP)
+ sbut->hBmp = psb->hBmp;
+ else
+ sbut->hBmp = 0;
+
+ if(psb->fMask & SBBF_ENHMETAFILE)
+ sbut->hEmf = psb->hEmf;
+ else
+ sbut->hEmf = 0;
+
+ if(psb->fMask & SBBF_CURSOR)
+ sbut->hCurs = psb->hCurs;
+ else
+ sbut->hCurs = 0;
+
+ /*
+ We don't use the callback function anymore. The uButType
+ member must now specify SBBT_OWNERDRAW, and a WM_NOTIFY will
+ be sent when a button must be drawn
+ if((psb->fMask & SBBF_OWNERDRAW) && ((psb->uButType & SBBT_MASK) == SBBT_OWNERDRAW))
+ pDrawProc = psb->pDrawProc;
+ else
+ pDrawProc = 0;*/
+
+ sbar->nButtons++;
+ sbut->nSizeReserved = sbut->nSize;
+
+ //MAKE SURE that any resizable buttons are only to the left / above
+ //a scrollbar. We don't support resize operations to the right of a scrollbar
+ if((sbut->uButType & SBBM_RESIZABLE) && sbut->uPlacement == SBBP_RIGHT)
+ sbut->uButType &= ~SBBM_RESIZABLE;
+
+ if(psb->fMask & SBBF_BUTMINMAX)
+ {
+ sbut->nMinSize = psb->nMinSize;
+ sbut->nMaxSize = psb->nMaxSize;
+ }
+ else
+ {
+ sbut->nMinSize = 0;
+ sbut->nMaxSize = -1;
+ }
+
+ return TRUE;
+}
+
+static SCROLLBUT *GetButtonFromId(SCROLLBAR *sbar, UINT uCmdId)
+{
+ int i;
+ for(i = 0; i < sbar->nButtons; i++)
+ {
+ if(sbar->sbButtons[i].uCmdId == uCmdId)
+ return &sbar->sbButtons[i];
+ }
+
+ return 0;
+}
+
+//
+// Modify the properties of the specified scrollbar button.
+// wSBflags - SB_HORZ / SB_VERT only
+// uItem - the command identifier specified when the button was created,
+// or a non-negative position of the button, depending on if
+// fByCmd is FALSE or TRUE, respectively
+//
+BOOL WINAPI CoolSB_ModifyButton (HWND hwnd, int wSBflags, UINT uItem, BOOL fByCmd, SCROLLBUT *psb)
+{
+ SCROLLBAR *sbar;
+ SCROLLBUT *sbut;
+
+ if(!psb) return FALSE;
+
+ //find if this window is CoolScroll enabled
+ if(!(sbar = GetScrollBarFromHwnd(hwnd, wSBflags)))
+ return FALSE;
+
+ //find the button to modify, depending on if we
+ //are modifying by position or command id
+ if(fByCmd == FALSE)
+ {
+ //button from position
+ if((int)uItem < 0 || (int)uItem >= (UINT)sbar->nButtons)
+ return FALSE;
+ else
+ sbut = &sbar->sbButtons[uItem];
+ }
+ else if(fByCmd == TRUE)
+ {
+ //button from command identifier
+ if(!(sbut = GetButtonFromId(sbar, uItem)))
+ return FALSE;
+ }
+
+ if(psb->fMask & SBBF_TYPE) sbut->uButType = psb->uButType;
+ if(psb->fMask & SBBF_STATE) sbut->uState = psb->uState;
+ if(psb->fMask & SBBF_ID) sbut->uCmdId = psb->uCmdId;
+ if(psb->fMask & SBBF_SIZE) sbut->nSize = psb->nSize;
+ if(psb->fMask & SBBF_PLACEMENT) sbut->uPlacement = psb->uPlacement;
+ if(psb->fMask & SBBF_BITMAP) sbut->hBmp = psb->hBmp;
+ if(psb->fMask & SBBF_ENHMETAFILE) sbut->hEmf = psb->hEmf;
+ if(psb->fMask & SBBF_CURSOR) sbut->hCurs = psb->hCurs;
+
+ if(psb->fMask & SBBF_BUTMINMAX)
+ {
+ sbut->nMinSize = psb->nMinSize;
+ sbut->nMaxSize = psb->nMaxSize;
+ }
+
+ return TRUE;
+}
+
+BOOL WINAPI CoolSB_RemoveButton(HWND hwnd, int wSBflags, UINT uItem, BOOL fByCmd)
+{
+ int i;
+ SCROLLBAR *sbar;
+
+ //find if this window is CoolScroll enabled
+ if(!(sbar = GetScrollBarFromHwnd(hwnd, wSBflags)))
+ return FALSE;
+
+ //find the button to modify, depending on if we
+ //are modifying by position or command id
+ if(fByCmd == FALSE && ((int)uItem < 0 || (int)uItem >= (UINT)sbar->nButtons))
+ {
+ return FALSE;
+ }
+ else if(fByCmd == TRUE)
+ {
+ //find the button with the specified command id
+ for(i = 0; i < sbar->nButtons; i++)
+ {
+ if(sbar->sbButtons[i].uCmdId == uItem)
+ {
+ //change the id to an index
+ uItem = i;
+ break;
+ }
+ }
+
+ //if we failed to find the button...
+ if(i == sbar->nButtons) return FALSE;
+ }
+
+ //remove the button!
+ for(i = uItem; i < sbar->nButtons - 1; i++)
+ {
+ sbar->sbButtons[i] = sbar->sbButtons[i+1];
+ }
+
+ sbar->nButtons--;
+
+ RedrawNonClient(hwnd, TRUE);
+
+ return TRUE;
+}
+
+//
+// fill in the supplied SCROLLBUT structure
+//
+BOOL WINAPI CoolSB_GetButton(HWND hwnd, int wSBflags, UINT uItem, BOOL fByCmd, SCROLLBUT *psb)
+{
+ SCROLLBAR *sbar;
+ SCROLLBUT *sbut;
+
+ if(!psb) return FALSE;
+
+ //find if this window is CoolScroll enabled
+ if(!(sbar = GetScrollBarFromHwnd(hwnd, wSBflags)))
+ return FALSE;
+
+ //find the button to modify, depending on if we
+ //are modifying by position or command id
+ if(fByCmd == FALSE)
+ {
+ //button from position
+ if((int)uItem < 0 || (int)uItem >= (UINT)sbar->nButtons)
+ return FALSE;
+ else
+ sbut = &sbar->sbButtons[uItem];
+ }
+ else if(fByCmd == TRUE)
+ {
+ //button from command identifier
+ if(!(sbut = GetButtonFromId(sbar, uItem)))
+ return FALSE;
+ }
+
+ //copy them across
+ *psb = *sbut;
+
+ return FALSE;
+}
+
+#else
+
+BOOL WINAPI CoolSB_InsertButton(HWND hwnd, int wSBflags, UINT nPos, SCROLLBUT *psb) { return FALSE; }
+BOOL WINAPI CoolSB_ModifyButton(HWND hwnd, int wSBflags, UINT uItem, BOOL fByCmd, SCROLLBUT *psb) { return FALSE; }
+BOOL WINAPI CoolSB_RemoveButton(HWND hwnd, int wSBflags, UINT uItem, BOOL fByCmd) { return FALSE; }
+BOOL WINAPI CoolSB_GetButton (HWND hwnd, int wSBflags, UINT uItem, BOOL fByCmd, SCROLLBUT *psb) { return FALSE; }
+
+#endif //INCLUDE_BUTTONS
+
+//
+// Set the size of the scrollbars
+//
+BOOL WINAPI CoolSB_SetSize (HWND hwnd, int wBar, int nLength, int nWidth)
+{
+ SCROLLBAR *sbar;
+
+ if(nLength == 0 || nWidth == 0)
+ return FALSE;
+
+ if(nLength < -8 || nWidth < -8)
+ return FALSE;
+
+ if(nLength > 256 || nWidth > 256)
+ return FALSE;
+
+ if(!GetScrollWndFromHwnd(hwnd))
+ return FALSE;
+
+ if((wBar == SB_HORZ || wBar == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_HORZ)))
+ {
+ sbar->nArrowLength = nLength;
+ sbar->nArrowWidth = nWidth;
+ }
+
+ if((wBar == SB_VERT || wBar == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_VERT)))
+ {
+ sbar->nArrowLength = nLength;
+ sbar->nArrowWidth = nWidth;
+ }
+
+ RedrawNonClient(hwnd, TRUE);
+
+ return TRUE;
+}
+
+
+//
+// Alter the display mode of the scrollbars
+// wBar - SB_HORZ / SB_VERT / SB_BOTH
+// nStyle - CSBF_NORMAL / CSBF_FLAT / CSBF_HOTTRACKED
+//
+BOOL WINAPI CoolSB_SetStyle(HWND hwnd, int wBar, UINT nStyle)
+{
+ SCROLLBAR *sbar;
+
+ if(!GetScrollWndFromHwnd(hwnd))
+ return FALSE;
+
+ if((wBar == SB_HORZ || wBar == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_HORZ)))
+ {
+ sbar->fFlatScrollbar = nStyle;
+ }
+
+ if((wBar == SB_VERT || wBar == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_VERT)))
+ {
+ sbar->fFlatScrollbar = nStyle;
+ }
+
+ RedrawNonClient(hwnd, FALSE);
+
+ return TRUE;
+}
+
+//
+// Set if the thumb is always visible, even if there is no data to
+// scroll. Setting this keeps the scrollbar enabled, but the thumb
+// covers the whole area
+//
+BOOL WINAPI CoolSB_SetThumbAlways(HWND hwnd, int wBar, BOOL fThumbAlways)
+{
+ SCROLLBAR *sbar;
+
+ if(!GetScrollWndFromHwnd(hwnd))
+ return FALSE;
+
+ if((wBar == SB_HORZ || wBar == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_HORZ)))
+ {
+ if(fThumbAlways)
+ sbar->fScrollFlags |= CSBS_THUMBALWAYS;
+ else
+ sbar->fScrollFlags &= ~CSBS_THUMBALWAYS;
+ }
+
+ if((wBar == SB_VERT || wBar == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_VERT)))
+ {
+ if(fThumbAlways)
+ sbar->fScrollFlags |= CSBS_THUMBALWAYS;
+ else
+ sbar->fScrollFlags &= ~CSBS_THUMBALWAYS;
+ }
+
+ RedrawNonClient(hwnd, FALSE);
+
+ return TRUE;
+}
+
+//
+// Set the minimum size, in pixels, that the thumb box will shrink to.
+//
+BOOL WINAPI CoolSB_SetMinThumbSize(HWND hwnd, UINT wBar, UINT size)
+{
+ SCROLLBAR *sbar;
+
+ if(!GetScrollWndFromHwnd(hwnd))
+ return FALSE;
+
+ if(size == -1)
+ size = CoolSB_GetDefaultMinThumbSize();
+
+ if((wBar == SB_HORZ || wBar == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_HORZ)))
+ {
+ sbar->nMinThumbSize = size;
+ }
+
+ if((wBar == SB_VERT || wBar == SB_BOTH) &&
+ (sbar = GetScrollBarFromHwnd(hwnd, SB_VERT)))
+ {
+ sbar->nMinThumbSize = size;
+ }
+
+ return TRUE;
+}
diff --git a/plugins/Clist_ng/coolsb/coolsblib.h b/plugins/Clist_ng/coolsb/coolsblib.h new file mode 100644 index 0000000000..d9b1c711f3 --- /dev/null +++ b/plugins/Clist_ng/coolsb/coolsblib.h @@ -0,0 +1,41 @@ +#ifndef _SUPERSCROLL_INCLUDED
+#define _SUPERSCROLL_INCLUDED
+
+#ifdef __cplusplus
+extern "C"{
+#endif
+
+#include <windows.h>
+
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/plugins/Clist_ng/coolsb/coolscroll.cpp b/plugins/Clist_ng/coolsb/coolscroll.cpp new file mode 100644 index 0000000000..1a056fe301 --- /dev/null +++ b/plugins/Clist_ng/coolsb/coolscroll.cpp @@ -0,0 +1,3214 @@ +/*
+ Cool Scrollbar Library Version 1.2
+
+ Module: coolscroll.c
+ Copyright (c) J Brown 2001
+
+ This code is freeware, however, you may not publish
+ this code elsewhere or charge any money for it. This code
+ is supplied as-is. I make no guarantees about the suitability
+ of this code - use at your own risk.
+
+ It would be nice if you credited me, in the event
+ that you use this code in a product.
+
+ VERSION HISTORY:
+
+ V1.2: TreeView problem fixed by Diego Tartara
+ Small problem in thumbsize calculation also fixed (thanks Diego!)
+
+ V1.1: Added support for Right-left windows
+ Changed calling convention of APIs to WINAPI (__stdcall)
+ Completely standalone (no need for c-runtime)
+ Now supports ALL windows with appropriate USER32.DLL patching
+ (you provide!!)
+
+ V1.0: Apr 2001: Initial Version
+
+ IMPORTANT:
+ This whole library is based around code for a horizontal scrollbar.
+ All "vertical" scrollbar drawing / mouse interaction uses the
+ horizontal scrollbar functions, but uses a trick to convert the vertical
+ scrollbar coordinates into horizontal equivelants. When I started this project,
+ I quickly realised that the code for horz/vert bars was IDENTICAL, apart
+ from the fact that horizontal code uses left/right coords, and vertical code
+ uses top/bottom coords. On entry to a "vertical" drawing function, for example,
+ the coordinates are "rotated" before the horizontal function is called, and
+ then rotated back once the function has completed. When something needs to
+ be drawn, the coords are converted back again before drawing.
+
+ This trick greatly reduces the amount of code required, and makes
+ maintanence much simpler. This way, only one function is needed to draw
+ a scrollbar, but this can be used for both horizontal and vertical bars
+ with careful thought.
+*/
+
+#define _WIN32_WINNT 0x0502
+#define _WIN32_IE 0x0501
+
+#include <commonheaders.h>
+#include "coolscroll.h"
+#include "userdefs.h"
+#include "coolsb_internal.h"
+
+//define some values if the new version of common controls
+//is not available.
+#ifndef NM_CUSTOMDRAW
+#define NM_CUSTOMDRAW (NM_FIRST-12)
+#define CDRF_DODEFAULT 0x0000
+#define CDRF_SKIPDEFAULT 0x0004
+#define CDDS_PREPAINT 0x0001
+#define CDDS_POSTPAINT 0x0002
+#endif
+
+//
+// Special thumb-tracking variables
+//
+//
+static UINT uCurrentScrollbar = COOLSB_NONE; //SB_HORZ / SB_VERT
+static UINT uCurrentScrollPortion = HTSCROLL_NONE;
+static UINT uCurrentButton = 0;
+
+static RECT rcThumbBounds; //area that the scroll thumb can travel in
+static int nThumbSize; //(pixels)
+static int nThumbPos; //(pixels)
+static int nThumbMouseOffset; //(pixels)
+static int nLastPos = -1; //(scrollbar units)
+static int nThumbPos0; //(pixels) initial thumb position
+
+//
+// Temporary state used to auto-generate timer messages
+//
+static UINT_PTR uMouseOverId = 0;
+static UINT uMouseOverScrollbar = COOLSB_NONE;
+static UINT uHitTestPortion = HTSCROLL_NONE;
+static UINT uLastHitTestPortion = HTSCROLL_NONE;
+static RECT MouseOverRect;
+
+static UINT uScrollTimerMsg = 0;
+static UINT uScrollTimerPortion = HTSCROLL_NONE;
+static UINT_PTR uScrollTimerId = 0;
+static HWND hwndCurCoolSB = 0;
+
+extern int CustomDrawScrollBars(NMCSBCUSTOMDRAW *nmcsbcd);
+
+//
+// Provide this so there are NO dependencies on CRT
+//
+static void CoolSB_ZeroMemory(void *ptr, DWORD bytes)
+{
+ BYTE *bptr = (BYTE *)ptr;
+
+ while(bytes--) *bptr++ = 0;
+}
+
+BOOL WINAPI CoolSB_IsThumbTracking(HWND hwnd)
+{
+ SCROLLWND *sw;
+
+ if((sw = GetScrollWndFromHwnd(hwnd)) == NULL)
+ return FALSE;
+ else
+ return sw->fThumbTracking;
+}
+
+//
+// swap the rectangle's x coords with its y coords
+//
+static void __stdcall RotateRect(RECT *rect)
+{
+ int temp;
+ temp = rect->left;
+ rect->left = rect->top;
+ rect->top = temp;
+
+ temp = rect->right;
+ rect->right = rect->bottom;
+ rect->bottom = temp;
+}
+
+//
+// swap the coords if the scrollbar is a SB_VERT
+//
+static void __stdcall RotateRect0(SCROLLBAR *sb, RECT *rect)
+{
+ if(sb->nBarType == SB_VERT)
+ RotateRect(rect);
+}
+
+//
+// Calculate if the SCROLLINFO members produce
+// an enabled or disabled scrollbar
+//
+static BOOL IsScrollInfoActive(SCROLLINFO *si)
+{
+ if((si->nPage > (UINT)si->nMax
+ || si->nMax <= si->nMin || si->nMax == 0))
+ return FALSE;
+ else
+ return TRUE;
+}
+
+//
+// Return if the specified scrollbar is enabled or not
+//
+static BOOL IsScrollbarActive(SCROLLBAR *sb)
+{
+ SCROLLINFO *si = &sb->scrollInfo;
+ if(((sb->fScrollFlags & ESB_DISABLE_BOTH) == ESB_DISABLE_BOTH) ||
+ !(sb->fScrollFlags & CSBS_THUMBALWAYS) && !IsScrollInfoActive(si))
+ return FALSE;
+ else
+ return TRUE;
+}
+
+//
+// Draw a standard scrollbar arrow
+//
+static int DrawScrollArrow(SCROLLBAR *sbar, HDC hdc, RECT *rect, UINT arrow, BOOL fMouseDown, BOOL fMouseOver)
+{
+ UINT ret;
+ UINT flags = arrow;
+
+ //HACKY bit so this routine can be called by vertical and horizontal code
+ if(sbar->nBarType == SB_VERT)
+ {
+ if(flags & DFCS_SCROLLLEFT) flags = flags & ~DFCS_SCROLLLEFT | DFCS_SCROLLUP;
+ if(flags & DFCS_SCROLLRIGHT) flags = flags & ~DFCS_SCROLLRIGHT | DFCS_SCROLLDOWN;
+ }
+
+ if(fMouseDown) flags |= (DFCS_FLAT | DFCS_PUSHED);
+
+#ifdef FLAT_SCROLLBARS
+ if(sbar->fFlatScrollbar != CSBS_NORMAL)
+ {
+ HDC hdcmem1, hdcmem2;
+ HBITMAP hbm1, oldbm1;
+ HBITMAP hbm2, oldbm2;
+ RECT rc;
+ int width, height;
+
+ rc = *rect;
+ width = rc.right-rc.left;
+ height = rc.bottom-rc.top;
+ SetRect(&rc, 0, 0, width, height);
+
+ //MONOCHROME bitmap to convert the arrow to black/white mask
+ hdcmem1 = CreateCompatibleDC(hdc);
+ hbm1 = CreateBitmap(width, height, 1, 1, NULL);
+ UnrealizeObject(hbm1);
+ oldbm1 = reinterpret_cast<HBITMAP>(SelectObject(hdcmem1, hbm1));
+
+
+ //NORMAL bitmap to draw the arrow into
+ hdcmem2 = CreateCompatibleDC(hdc);
+ hbm2 = CreateCompatibleBitmap(hdc, width, height);
+ UnrealizeObject(hbm2);
+ oldbm2 = reinterpret_cast<HBITMAP>(SelectObject(hdcmem2, hbm2));
+
+
+ flags = flags & ~DFCS_PUSHED | DFCS_FLAT; //just in case
+ DrawFrameControl(hdcmem2, &rc, DFC_SCROLL, flags);
+
+
+#ifndef HOT_TRACKING
+ if(fMouseDown)
+ {
+ //uncomment these to make the cool scrollbars
+ //look like the common controls flat scrollbars
+ //fMouseDown = FALSE;
+ //fMouseOver = TRUE;
+ }
+#endif
+ //draw a flat monochrome version of a scrollbar arrow (dark)
+ if(fMouseDown)
+ {
+ SetBkColor(hdcmem2, GetSysColor(COLOR_BTNTEXT));
+ BitBlt(hdcmem1, 0, 0, width, height, hdcmem2, 0, 0, SRCCOPY);
+ SetBkColor(hdc, 0x00ffffff);
+ SetTextColor(hdc, GetSysColor(COLOR_3DDKSHADOW));
+ BitBlt(hdc, rect->left, rect->top, width, height, hdcmem1, 0, 0, SRCCOPY);
+ }
+ //draw a flat monochrome version of a scrollbar arrow (grey)
+ else if(fMouseOver)
+ {
+ SetBkColor(hdcmem2, GetSysColor(COLOR_BTNTEXT));
+ FillRect(hdcmem1, &rc, reinterpret_cast<HBRUSH>(GetStockObject(WHITE_BRUSH)));
+ BitBlt(hdcmem1, 0, 0, width, height, hdcmem2, 0, 0, SRCINVERT);
+
+ SetBkColor(hdc, GetSysColor(COLOR_3DSHADOW));
+ SetTextColor(hdc, 0x00ffffff);
+ BitBlt(hdc, rect->left, rect->top, width, height, hdcmem1, 0, 0, SRCCOPY);
+ }
+ //draw the arrow normally
+ else
+ {
+ BitBlt(hdc, rect->left, rect->top, width, height, hdcmem2, 0, 0, SRCCOPY);
+ }
+
+ SelectObject(hdcmem1, oldbm1);
+ SelectObject(hdcmem2, oldbm2);
+ DeleteObject(hbm1);
+ DeleteObject(hbm2);
+ DeleteDC(hdcmem1);
+ DeleteDC(hdcmem2);
+
+ ret = 0;
+ }
+ else
+#endif
+ ret = DrawFrameControl(hdc, rect, DFC_SCROLL, flags);
+
+ return ret;
+}
+
+//
+// Return the size in pixels for the specified scrollbar metric,
+// for the specified scrollbar
+//
+static int GetScrollMetric(SCROLLBAR *sbar, int metric)
+{
+ if(sbar->nBarType == SB_HORZ)
+ {
+ if(metric == SM_CXHORZSB)
+ {
+ if(sbar->nArrowLength < 0)
+ return -sbar->nArrowLength * GetSystemMetrics(SM_CXHSCROLL);
+ else
+ return sbar->nArrowLength;
+ }
+ else
+ {
+ if(sbar->nArrowWidth < 0)
+ return -sbar->nArrowWidth * GetSystemMetrics(SM_CYHSCROLL);
+ else
+ return sbar->nArrowWidth;
+ }
+ }
+ else if(sbar->nBarType == SB_VERT)
+ {
+ if(metric == SM_CYVERTSB)
+ {
+ if(sbar->nArrowLength < 0)
+ return -sbar->nArrowLength * GetSystemMetrics(SM_CYVSCROLL);
+ else
+ return sbar->nArrowLength;
+ }
+ else
+ {
+ if(sbar->nArrowWidth < 0)
+ return -sbar->nArrowWidth * GetSystemMetrics(SM_CXVSCROLL);
+ else
+ return sbar->nArrowWidth;
+ }
+ }
+
+ return 0;
+}
+
+//
+//
+//
+static COLORREF GetSBForeColor(void)
+{
+ COLORREF c1 = GetSysColor(COLOR_3DHILIGHT);
+ COLORREF c2 = GetSysColor(COLOR_WINDOW);
+
+ if(c1 != 0xffffff && c1 == c2)
+ {
+ return GetSysColor(COLOR_BTNFACE);
+ }
+ else
+ {
+ return GetSysColor(COLOR_3DHILIGHT);
+ }
+}
+
+static COLORREF GetSBBackColor(void)
+{
+ return GetSysColor(COLOR_SCROLLBAR);
+}
+
+//
+// Paint a checkered rectangle, with each alternate
+// pixel being assigned a different colour
+//
+static void DrawCheckedRect(HDC hdc, RECT *rect, COLORREF fg, COLORREF bg)
+{
+ static WORD wCheckPat[8] =
+ {
+ 0xaaaa, 0x5555, 0xaaaa, 0x5555, 0xaaaa, 0x5555, 0xaaaa, 0x5555
+ };
+
+ HBITMAP hbmp;
+ HBRUSH hbr, hbrold;
+ COLORREF fgold, bgold;
+
+ hbmp = CreateBitmap(8, 8, 1, 1, wCheckPat);
+ hbr = CreatePatternBrush(hbmp);
+
+ UnrealizeObject(hbr);
+ SetBrushOrgEx(hdc, rect->left, rect->top, 0);
+
+ hbrold = (HBRUSH)SelectObject(hdc, hbr);
+
+ fgold = SetTextColor(hdc, fg);
+ bgold = SetBkColor(hdc, bg);
+
+ PatBlt(hdc, rect->left, rect->top,
+ rect->right - rect->left,
+ rect->bottom - rect->top,
+ PATCOPY);
+
+ SetBkColor(hdc, bgold);
+ SetTextColor(hdc, fgold);
+
+ SelectObject(hdc, hbrold);
+ DeleteObject(hbr);
+ DeleteObject(hbmp);
+}
+
+//
+// Fill the specifed rectangle using a solid colour
+//
+static void PaintRect(HDC hdc, RECT *rect, COLORREF color)
+{
+ COLORREF oldcol = SetBkColor(hdc, color);
+ ExtTextOutA(hdc, 0, 0, ETO_OPAQUE, rect, "", 0, NULL);
+ SetBkColor(hdc, oldcol);
+}
+
+//
+// Draw a simple blank scrollbar push-button. Can be used
+// to draw a push button, or the scrollbar thumb
+// drawflag - could set to BF_FLAT to make flat scrollbars
+//
+void DrawBlankButton(HDC hdc, const RECT *rect, UINT drawflag)
+{
+ RECT rc = *rect;
+
+#ifndef FLAT_SCROLLBARS
+ drawflag &= ~BF_FLAT;
+#endif
+
+ DrawEdge(hdc, &rc, EDGE_RAISED, BF_RECT | drawflag | BF_ADJUST);
+ FillRect(hdc, &rc, GetSysColorBrush(COLOR_BTNFACE));
+}
+
+//
+// Send a WM_VSCROLL or WM_HSCROLL message
+//
+static void SendScrollMessage(HWND hwnd, UINT scrMsg, UINT scrId, UINT pos)
+{
+ SendMessage(hwnd, scrMsg, MAKEWPARAM(scrId, pos), 0);
+}
+
+//
+// Calculate the screen coordinates of the area taken by
+// the horizontal scrollbar. Take into account the size
+// of the window borders
+//
+static BOOL GetHScrollRect(SCROLLWND *sw, HWND hwnd, RECT *rect)
+{
+ GetWindowRect(hwnd, rect);
+
+ if(sw->fLeftScrollbar)
+ {
+ rect->left += sw->cxLeftEdge + (sw->sbarVert.fScrollVisible ?
+ GetScrollMetric(&sw->sbarVert, SM_CXVERTSB) : 0);
+ rect->right -= sw->cxRightEdge;
+ }
+ else
+ {
+ rect->left += sw->cxLeftEdge; //left window edge
+
+ rect->right -= sw->cxRightEdge + //right window edge
+ (sw->sbarVert.fScrollVisible ?
+ GetScrollMetric(&sw->sbarVert, SM_CXVERTSB) : 0);
+ }
+
+ rect->bottom -= sw->cyBottomEdge; //bottom window edge
+
+ rect->top = rect->bottom -
+ (sw->sbarHorz.fScrollVisible ?
+ GetScrollMetric(&sw->sbarHorz, SM_CYHORZSB) : 0);
+
+ return TRUE;
+}
+
+//
+// Calculate the screen coordinates of the area taken by the
+// vertical scrollbar
+//
+static BOOL GetVScrollRect(SCROLLWND *sw, HWND hwnd, RECT *rect)
+{
+ GetWindowRect(hwnd, rect);
+ rect->top += sw->cyTopEdge; //top window edge
+
+ rect->bottom -= sw->cyBottomEdge +
+ (sw->sbarHorz.fScrollVisible ? //bottom window edge
+ GetScrollMetric(&sw->sbarHorz, SM_CYHORZSB) : 0);
+
+ if(sw->fLeftScrollbar)
+ {
+ rect->left += sw->cxLeftEdge;
+ rect->right = rect->left + (sw->sbarVert.fScrollVisible ?
+ GetScrollMetric(&sw->sbarVert, SM_CXVERTSB) : 0);
+ }
+ else
+ {
+ rect->right -= sw->cxRightEdge;
+ rect->left = rect->right - (sw->sbarVert.fScrollVisible ?
+ GetScrollMetric(&sw->sbarVert, SM_CXVERTSB) : 0);
+ }
+
+ return TRUE;
+}
+
+// Depending on what type of scrollbar nBar refers to, call the
+// appropriate Get?ScrollRect function
+//
+BOOL GetScrollRect(SCROLLWND *sw, UINT nBar, HWND hwnd, RECT *rect)
+{
+ if(nBar == SB_HORZ)
+ return GetHScrollRect(sw, hwnd, rect);
+ else if(nBar == SB_VERT)
+ return GetVScrollRect(sw, hwnd, rect);
+ else
+ return FALSE;
+}
+
+//
+// This code is a prime candidate for splitting out into a separate
+// file at some stage
+//
+#ifdef INCLUDE_BUTTONS
+
+//
+// Calculate the size in pixels of the specified button
+//
+static int GetSingleButSize(SCROLLBAR *sbar, SCROLLBUT *sbut)
+{
+ //multiple of the system button size
+ //or a specific button size
+ if(sbut->nSize < 0)
+ {
+ if(sbar->nBarType == SB_HORZ)
+ return -sbut->nSize * GetSystemMetrics(SM_CXHSCROLL);
+ else
+ return -sbut->nSize * GetSystemMetrics(SM_CYVSCROLL);
+ }
+ else
+ return sbut->nSize;
+}
+
+//
+// Find the size in pixels of all the inserted buttons,
+// either before or after the specified scrollbar
+//
+static int GetButtonSize(SCROLLBAR *sbar, HWND hwnd, UINT uBeforeAfter)
+{
+ int i;
+ int nPixels = 0;
+
+ SCROLLBUT *sbut = sbar->sbButtons;
+
+ for(i = 0; i < sbar->nButtons; i++)
+ {
+ //only consider those buttons on the same side as nTopBottom says
+ if(sbut[i].uPlacement == uBeforeAfter)
+ {
+ nPixels += GetSingleButSize(sbar, &sbut[i]);
+ }
+ }
+
+ return nPixels;
+}
+#endif //INCLUDE_BUTTONS
+
+//
+// Work out the scrollbar width/height for either type of scrollbar (SB_HORZ/SB_VERT)
+// rect - coords of the scrollbar.
+// store results into *thumbsize and *thumbpos
+//
+static int CalcThumbSize(SCROLLBAR *sbar, const RECT *rect, int *pthumbsize, int *pthumbpos)
+{
+ SCROLLINFO *si;
+ int scrollsize; //total size of the scrollbar including arrow buttons
+ int workingsize; //working area (where the thumb can slide)
+ int siMaxMin;
+ int butsize;
+ int startcoord;
+ int thumbpos = 0, thumbsize = 0;
+
+ static int count=0;
+
+ //work out the width (for a horizontal) or the height (for a vertical)
+ //of a standard scrollbar button
+ butsize = GetScrollMetric(sbar, SM_SCROLL_LENGTH);
+
+ if(1) //sbar->nBarType == SB_HORZ)
+ {
+ scrollsize = rect->right - rect->left;
+ startcoord = rect->left;
+ }
+ /*else if(sbar->nBarType == SB_VERT)
+ {
+ scrollsize = rect->bottom - rect->top;
+ startcoord = rect->top;
+ }
+ else
+ {
+ return 0;
+ }*/
+
+ si = &sbar->scrollInfo;
+ siMaxMin = si->nMax - si->nMin + 1;
+ workingsize = scrollsize - butsize * 2;
+
+ //
+ // Work out the scrollbar thumb SIZE
+ //
+ if(si->nPage == 0)
+ {
+ thumbsize = butsize;
+ }
+ else if(siMaxMin > 0)
+ {
+ thumbsize = MulDiv(si->nPage, workingsize, siMaxMin);
+
+ if(thumbsize < sbar->nMinThumbSize)
+ thumbsize = sbar->nMinThumbSize;
+ }
+
+ //
+ // Work out the scrollbar thumb position
+ //
+ if(siMaxMin > 0)
+ {
+ int pagesize = max(1, si->nPage);
+ thumbpos = MulDiv(si->nPos - si->nMin, workingsize-thumbsize, siMaxMin - pagesize);
+
+ if(thumbpos < 0)
+ thumbpos = 0;
+
+ if(thumbpos >= workingsize-thumbsize)
+ thumbpos = workingsize-thumbsize;
+ }
+
+ thumbpos += startcoord + butsize;
+
+ *pthumbpos = thumbpos;
+ *pthumbsize = thumbsize;
+
+ return 1;
+}
+
+//
+// return a hit-test value for whatever part of the scrollbar x,y is located in
+// rect, x, y: SCREEN coordinates
+// the rectangle must not include space for any inserted buttons
+// (i.e, JUST the scrollbar area)
+//
+static UINT GetHorzScrollPortion(SCROLLBAR *sbar, HWND hwnd, const RECT *rect, int x, int y)
+{
+ int thumbwidth, thumbpos;
+ int butwidth = GetScrollMetric(sbar, SM_SCROLL_LENGTH);
+ int scrollwidth = rect->right-rect->left;
+ int workingwidth = scrollwidth - butwidth*2;
+
+ if(y < rect->top || y >= rect->bottom)
+ return HTSCROLL_NONE;
+
+ CalcThumbSize(sbar, rect, &thumbwidth, &thumbpos);
+
+ //if we have had to scale the buttons to fit in the rect,
+ //then adjust the button width accordingly
+ if(scrollwidth <= butwidth * 2)
+ {
+ butwidth = scrollwidth / 2;
+ }
+
+ //check for left button click
+ if(x >= rect->left && x < rect->left + butwidth)
+ {
+ return HTSCROLL_LEFT;
+ }
+ //check for right button click
+ else if(x >= rect->right-butwidth && x < rect->right)
+ {
+ return HTSCROLL_RIGHT;
+ }
+
+ //if the thumb is too big to fit (i.e. it isn't visible)
+ //then return a NULL scrollbar area
+ if(thumbwidth >= workingwidth)
+ return HTSCROLL_NONE;
+
+ //check for point in the thumbbar
+ if(x >= thumbpos && x < thumbpos+thumbwidth)
+ {
+ return HTSCROLL_THUMB;
+ }
+ //check for left margin
+ else if(x >= rect->left+butwidth && x < thumbpos)
+ {
+ return HTSCROLL_PAGELEFT;
+ }
+ else if(x >= thumbpos+thumbwidth && x < rect->right-butwidth)
+ {
+ return HTSCROLL_PAGERIGHT;
+ }
+
+ return HTSCROLL_NONE;
+}
+
+//
+// For vertical scrollbars, rotate all coordinates by -90 degrees
+// so that we can use the horizontal version of this function
+//
+static UINT GetVertScrollPortion(SCROLLBAR *sb, HWND hwnd, RECT *rect, int x, int y)
+{
+ UINT r;
+
+ RotateRect(rect);
+ r = GetHorzScrollPortion(sb, hwnd, rect, y, x);
+ RotateRect(rect);
+ return r;
+}
+
+//
+// CUSTOM DRAW support
+//
+static LRESULT PostCustomPrePostPaint(HWND hwnd, HDC hdc, SCROLLBAR *sb, UINT dwStage)
+{
+#ifdef CUSTOM_DRAW
+ NMCSBCUSTOMDRAW nmcd;
+
+ CoolSB_ZeroMemory(&nmcd, sizeof nmcd);
+ nmcd.hdr.hwndFrom = hwnd;
+ nmcd.hdr.idFrom = GetWindowLongPtr(hwnd, GWLP_ID);
+ nmcd.hdr.code = NM_COOLSB_CUSTOMDRAW;
+ nmcd.nBar = sb->nBarType;
+ nmcd.dwDrawStage = dwStage;
+ nmcd.hdc = hdc;
+
+ hwnd = GetParent(hwnd);
+ return CustomDrawScrollBars(&nmcd);
+#else
+ return 0;
+#endif
+}
+
+static LRESULT PostCustomDrawNotify(HWND hwnd, HDC hdc, UINT nBar, RECT *prect, UINT nItem, BOOL fMouseDown, BOOL fMouseOver, BOOL fInactive)
+{
+#ifdef CUSTOM_DRAW
+ NMCSBCUSTOMDRAW nmcd;
+
+ //fill in the standard header
+ nmcd.hdr.hwndFrom = hwnd;
+ nmcd.hdr.idFrom = GetWindowLongPtr(hwnd, GWLP_ID);
+ nmcd.hdr.code = NM_COOLSB_CUSTOMDRAW;
+
+ nmcd.dwDrawStage = CDDS_ITEMPREPAINT;
+ nmcd.nBar = nBar;
+ nmcd.rect = *prect;
+ nmcd.uItem = nItem;
+ nmcd.hdc = hdc;
+
+ if(fMouseDown)
+ nmcd.uState = CDIS_SELECTED;
+ else if(fMouseOver)
+ nmcd.uState = CDIS_HOT;
+ else if(fInactive)
+ nmcd.uState = CDIS_DISABLED;
+ else
+ nmcd.uState = CDIS_DEFAULT;
+
+ hwnd = GetParent(hwnd);
+ return CustomDrawScrollBars(&nmcd);
+#else
+ return 0;
+#endif
+}
+
+// Depending on if we are supporting custom draw, either define
+// a macro to the function name, or to nothing at all. If custom draw
+// is turned off, then we can save ALOT of code space by binning all
+// calls to the custom draw support.
+
+/*
+#ifdef CUSTOM_DRAW
+#define PostCustomDrawNotify PostCustomDrawNotify0
+#define PostCustomPrePostPaint PostCustomPrePostPaint0
+#else
+#define PostCustomDrawNotify 1 ? (void)0 : PostCustomDrawNotify0
+#define PostCustomPrePostPaint 1 ? (void)0 : PostCustomPrePostPaint0
+#endif
+*/
+
+static LRESULT PostMouseNotify0(HWND hwnd, UINT msg, UINT nBar, RECT *prect, UINT nCmdId, POINT pt)
+{
+#ifdef NOTIFY_MOUSE
+ NMCOOLBUTMSG nmcb;
+
+ //fill in the standard header
+ nmcb.hdr.hwndFrom = hwnd;
+ nmcb.hdr.idFrom = GetWindowLongPtr(hwnd, GWLP_ID);
+ nmcb.hdr.code = NM_CLICK;
+
+ nmcb.nBar = nBar;
+ nmcb.uCmdId = nCmdId;
+ nmcb.uState = 0;
+ nmcb.rect = *prect;
+ nmcb.pt = pt;
+
+ hwnd = GetParent(hwnd);
+ return SendMessage(hwnd, WM_NOTIFY, nmcb.hdr.idFrom, (LPARAM)&nmcb);
+#else
+ return 0;
+#endif
+}
+
+#ifdef NOTIFY_MOUSE
+#define PostMouseNotify PostMouseNotify0
+#else
+#define PostMouseNotify 1 ? (void)0 : PostMouseNotify0
+#endif
+
+
+
+//
+// Draw a complete HORIZONTAL scrollbar in the given rectangle
+// Don't draw any inserted buttons in this procedure
+//
+// uDrawFlags - hittest code, to say if to draw the
+// specified portion in an active state or not.
+//
+//
+static LRESULT NCDrawHScrollbar(SCROLLBAR *sb, HWND hwnd, HDC hdc, const RECT *rect, UINT uDrawFlags)
+{
+ SCROLLINFO *si;
+ RECT ctrl, thumb;
+ RECT sbm;
+ int butwidth = GetScrollMetric(sb, SM_SCROLL_LENGTH);
+ int scrollwidth = rect->right-rect->left;
+ int workingwidth = scrollwidth - butwidth*2;
+ int thumbwidth = 0, thumbpos = 0;
+ int siMaxMin;
+
+ BOOL fCustomDraw = 1;
+
+ BOOL fMouseDownL = 0, fMouseOverL = 0, fBarHot = 0;
+ BOOL fMouseDownR = 0, fMouseOverR = 0;
+
+ COLORREF crCheck1 = GetSBForeColor();
+ COLORREF crCheck2 = GetSBBackColor();
+ COLORREF crInverse1 = InvertCOLORREF(crCheck1);
+ COLORREF crInverse2 = InvertCOLORREF(crCheck2);
+
+ //UINT uDFCFlat = sb->fFlatScrollbar ? DFCS_FLAT : 0;
+ UINT uDEFlat = sb->fFlatScrollbar ? BF_FLAT : 0;
+
+ //drawing flags to modify the appearance of the scrollbar buttons
+ UINT uLeftButFlags = DFCS_SCROLLLEFT;
+ UINT uRightButFlags = DFCS_SCROLLRIGHT;
+
+ if(scrollwidth <= 0)
+ return 0;
+
+ si = &sb->scrollInfo;
+ siMaxMin = si->nMax - si->nMin;
+
+ if(hwnd != hwndCurCoolSB)
+ uDrawFlags = HTSCROLL_NONE;
+ //
+ // work out the thumb size and position
+ //
+ CalcThumbSize(sb, rect, &thumbwidth, &thumbpos);
+
+ if(sb->fScrollFlags & ESB_DISABLE_LEFT) uLeftButFlags |= DFCS_INACTIVE;
+ if(sb->fScrollFlags & ESB_DISABLE_RIGHT) uRightButFlags |= DFCS_INACTIVE;
+
+ //if we need to grey the arrows because there is no data to scroll
+ if(!IsScrollInfoActive(si) && !(sb->fScrollFlags & CSBS_THUMBALWAYS))
+ {
+ uLeftButFlags |= DFCS_INACTIVE;
+ uRightButFlags |= DFCS_INACTIVE;
+ }
+
+ if(hwnd == hwndCurCoolSB)
+ {
+#ifdef FLAT_SCROLLBARS
+ BOOL ldis = !(uLeftButFlags & DFCS_INACTIVE);
+ BOOL rdis = !(uRightButFlags & DFCS_INACTIVE);
+
+ fBarHot = (sb->nBarType == (int)uMouseOverScrollbar && sb->fFlatScrollbar == CSBS_HOTTRACKED);
+
+ fMouseOverL = uHitTestPortion == HTSCROLL_LEFT && fBarHot && ldis;
+ fMouseOverR = uHitTestPortion == HTSCROLL_RIGHT && fBarHot && rdis;
+#endif
+ fMouseDownL = (uDrawFlags == HTSCROLL_LEFT);
+ fMouseDownR = (uDrawFlags == HTSCROLL_RIGHT);
+ }
+
+
+//#ifdef CUSTOM_DRAW
+ fCustomDraw = ((PostCustomPrePostPaint(hwnd, hdc, sb, CDDS_PREPAINT)) == CDRF_SKIPDEFAULT);
+ //#endif
+
+ //
+ // Draw the scrollbar now
+ //
+ if(scrollwidth > butwidth*2)
+ {
+ //LEFT ARROW
+ SetRect(&ctrl, rect->left, rect->top, rect->left + butwidth, rect->bottom);
+
+ RotateRect0(sb, &ctrl);
+
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &ctrl, SB_LINELEFT, fMouseDownL, fMouseOverL, uLeftButFlags & DFCS_INACTIVE);
+ else
+ DrawScrollArrow(sb, hdc, &ctrl, uLeftButFlags, fMouseDownL, fMouseOverL);
+
+ RotateRect0(sb, &ctrl);
+
+ //MIDDLE PORTION
+ //if we can fit the thumbbar in, then draw it
+ if(thumbwidth > 0 && thumbwidth <= workingwidth
+ && IsScrollInfoActive(si) && ((sb->fScrollFlags & ESB_DISABLE_BOTH) != ESB_DISABLE_BOTH))
+ {
+ //Draw the scrollbar margin above the thumb
+ SetRect(&sbm, rect->left + butwidth, rect->top, thumbpos, rect->bottom);
+
+ RotateRect0(sb, &sbm);
+
+ if(fCustomDraw)
+ {
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &sbm, SB_PAGELEFT, uDrawFlags == HTSCROLL_PAGELEFT, FALSE, FALSE);
+ }
+ else
+ {
+ if(uDrawFlags == HTSCROLL_PAGELEFT)
+ DrawCheckedRect(hdc, &sbm, crInverse1, crInverse2);
+ else
+ DrawCheckedRect(hdc, &sbm, crCheck1, crCheck2);
+
+ }
+
+ RotateRect0(sb, &sbm);
+
+ //Draw the margin below the thumb
+ sbm.left = thumbpos+thumbwidth;
+ sbm.right = rect->right - butwidth;
+
+ RotateRect0(sb, &sbm);
+ if(fCustomDraw)
+ {
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &sbm, SB_PAGERIGHT, uDrawFlags == HTSCROLL_PAGERIGHT, 0, 0);
+ }
+ else
+ {
+ if(uDrawFlags == HTSCROLL_PAGERIGHT)
+ DrawCheckedRect(hdc, &sbm, crInverse1, crInverse2);
+ else
+ DrawCheckedRect(hdc, &sbm, crCheck1, crCheck2);
+
+ }
+ RotateRect0(sb, &sbm);
+
+ //Draw the THUMB finally
+ SetRect(&thumb, thumbpos, rect->top, thumbpos+thumbwidth, rect->bottom);
+
+ RotateRect0(sb, &thumb);
+
+ if(fCustomDraw)
+ {
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &thumb, SB_THUMBTRACK, uDrawFlags==HTSCROLL_THUMB, uHitTestPortion == HTSCROLL_THUMB && fBarHot, FALSE);
+ }
+ else
+ {
+
+#ifdef FLAT_SCROLLBARS
+ if(hwnd == hwndCurCoolSB && sb->fFlatScrollbar && (uDrawFlags == HTSCROLL_THUMB ||
+ (uHitTestPortion == HTSCROLL_THUMB && fBarHot)))
+ {
+ PaintRect(hdc, &thumb, GetSysColor(COLOR_3DSHADOW));
+ }
+ else
+#endif
+ {
+ DrawBlankButton(hdc, &thumb, uDEFlat);
+ }
+ }
+ RotateRect0(sb, &thumb);
+
+ }
+ //otherwise, just leave that whole area blank
+ else
+ {
+ OffsetRect(&ctrl, butwidth, 0);
+ ctrl.right = rect->right - butwidth;
+
+ //if we always show the thumb covering the whole scrollbar,
+ //then draw it that way
+ if(!IsScrollInfoActive(si) && (sb->fScrollFlags & CSBS_THUMBALWAYS)
+ && ctrl.right - ctrl.left > sb->nMinThumbSize)
+ {
+ //leave a 1-pixel gap between the thumb + right button
+ ctrl.right --;
+ RotateRect0(sb, &ctrl);
+
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &ctrl, SB_THUMBTRACK, fMouseDownL, FALSE, FALSE);
+ else
+ {
+#ifdef FLAT_SCROLLBARS
+ if(sb->fFlatScrollbar == CSBS_HOTTRACKED && uDrawFlags == HTSCROLL_THUMB)
+ PaintRect(hdc, &ctrl, GetSysColor(COLOR_3DSHADOW));
+ else
+#endif
+ DrawBlankButton(hdc, &ctrl, uDEFlat);
+
+ }
+ RotateRect0(sb, &ctrl);
+
+ //draw the single-line gap
+ ctrl.left = ctrl.right;
+ ctrl.right += 1;
+
+ RotateRect0(sb, &ctrl);
+
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &ctrl, SB_PAGERIGHT, 0, 0, 0);
+ else
+ PaintRect(hdc, &ctrl, GetSysColor(COLOR_SCROLLBAR));
+
+ RotateRect0(sb, &ctrl);
+ }
+ //otherwise, paint a blank if the thumb doesn't fit in
+ else
+ {
+ RotateRect0(sb, &ctrl);
+
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &ctrl, SB_PAGERIGHT, 0, 0, 0);
+ else
+ DrawCheckedRect(hdc, &ctrl, crCheck1, crCheck2);
+
+ RotateRect0(sb, &ctrl);
+ }
+ }
+
+ //RIGHT ARROW
+ SetRect(&ctrl, rect->right - butwidth, rect->top, rect->right, rect->bottom);
+
+ RotateRect0(sb, &ctrl);
+
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &ctrl, SB_LINERIGHT, fMouseDownR, fMouseOverR, uRightButFlags & DFCS_INACTIVE);
+ else
+ DrawScrollArrow(sb, hdc, &ctrl, uRightButFlags, fMouseDownR, fMouseOverR);
+
+ RotateRect0(sb, &ctrl);
+ }
+ //not enough room for the scrollbar, so just draw the buttons (scaled in size to fit)
+ else
+ {
+ butwidth = scrollwidth / 2;
+
+ //LEFT ARROW
+ SetRect(&ctrl, rect->left, rect->top, rect->left + butwidth, rect->bottom);
+
+ RotateRect0(sb, &ctrl);
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &ctrl, SB_LINELEFT, fMouseDownL, fMouseOverL, uLeftButFlags & DFCS_INACTIVE);
+ else
+ DrawScrollArrow(sb, hdc, &ctrl, uLeftButFlags, fMouseDownL, fMouseOverL);
+ RotateRect0(sb, &ctrl);
+
+ //RIGHT ARROW
+ OffsetRect(&ctrl, scrollwidth - butwidth, 0);
+
+ RotateRect0(sb, &ctrl);
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &ctrl, SB_LINERIGHT, fMouseDownR, fMouseOverR, uRightButFlags & DFCS_INACTIVE);
+ else
+ DrawScrollArrow(sb, hdc, &ctrl, uRightButFlags, fMouseDownR, fMouseOverR);
+ RotateRect0(sb, &ctrl);
+
+ //if there is a gap between the buttons, fill it with a solid color
+ //if(butwidth & 0x0001)
+ if(ctrl.left != rect->left + butwidth)
+ {
+ ctrl.left --;
+ ctrl.right -= butwidth;
+ RotateRect0(sb, &ctrl);
+
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sb->nBarType, &ctrl, SB_PAGERIGHT, 0, 0, 0);
+ else
+ DrawCheckedRect(hdc, &ctrl, crCheck1, crCheck2);
+
+ RotateRect0(sb, &ctrl);
+ }
+
+ }
+
+//#ifdef CUSTOM_DRAW
+ PostCustomPrePostPaint(hwnd, hdc, sb, CDDS_POSTPAINT);
+//#endif
+
+ return fCustomDraw;
+}
+
+//
+// Draw a vertical scrollbar using the horizontal draw routine, but
+// with the coordinates adjusted accordingly
+//
+static LRESULT NCDrawVScrollbar(SCROLLBAR *sb, HWND hwnd, HDC hdc, const RECT *rect, UINT uDrawFlags)
+{
+ LRESULT ret;
+ RECT rc;
+
+ rc = *rect;
+ RotateRect(&rc);
+ ret = NCDrawHScrollbar(sb, hwnd, hdc, &rc, uDrawFlags);
+ RotateRect(&rc);
+
+ return ret;
+}
+
+//
+// Generic wrapper function for the scrollbar drawing
+//
+static LRESULT NCDrawScrollbar(SCROLLBAR *sb, HWND hwnd, HDC hdc, const RECT *rect, UINT uDrawFlags)
+{
+ if(sb->nBarType == SB_HORZ)
+ return NCDrawHScrollbar(sb, hwnd, hdc, rect, uDrawFlags);
+ else
+ return NCDrawVScrollbar(sb, hwnd, hdc, rect, uDrawFlags);
+}
+
+#ifdef INCLUDE_BUTTONS
+
+//
+// Draw the specified bitmap centered in the rectangle
+//
+static void DrawImage(HDC hdc, HBITMAP hBitmap, RECT *rc)
+{
+ BITMAP bm;
+ int cx;
+ int cy;
+ HDC memdc;
+ HBITMAP hOldBM;
+ RECT rcDest = *rc;
+ POINT p;
+ SIZE delta;
+ COLORREF colorOld;
+
+ if(hBitmap == NULL)
+ return;
+
+ // center bitmap in caller's rectangle
+ GetObject(hBitmap, sizeof bm, &bm);
+
+ cx = bm.bmWidth;
+ cy = bm.bmHeight;
+
+ delta.cx = (rc->right-rc->left - cx) / 2;
+ delta.cy = (rc->bottom-rc->top - cy) / 2;
+
+ if(rc->right-rc->left > cx)
+ {
+ SetRect(&rcDest, rc->left+delta.cx, rc->top + delta.cy, 0, 0);
+ rcDest.right = rcDest.left + cx;
+ rcDest.bottom = rcDest.top + cy;
+ p.x = 0;
+ p.y = 0;
+ }
+ else
+ {
+ p.x = -delta.cx;
+ p.y = -delta.cy;
+ }
+
+ // select checkmark into memory DC
+ memdc = CreateCompatibleDC(hdc);
+ hOldBM = (HBITMAP)SelectObject(memdc, hBitmap);
+
+ // set BG color based on selected state
+ colorOld = SetBkColor(hdc, GetSysColor(COLOR_3DFACE));
+
+ BitBlt(hdc, rcDest.left, rcDest.top, rcDest.right-rcDest.left, rcDest.bottom-rcDest.top, memdc, p.x, p.y, SRCCOPY);
+
+ // restore
+ SetBkColor(hdc, colorOld);
+ SelectObject(memdc, hOldBM);
+ DeleteDC(memdc);
+}
+
+//
+// Draw the specified metafile
+//
+static void DrawMetaFile(HDC hdc, HENHMETAFILE hemf, RECT *rect)
+{
+ RECT rc;
+ POINT pt;
+
+ SetRect(&rc, 0, 0, rect->right-rect->left, rect->bottom-rect->top);
+ SetWindowOrgEx(hdc, -rect->left, -rect->top, &pt);
+ PlayEnhMetaFile(hdc, hemf, &rc);
+ SetWindowOrgEx(hdc, pt.x, pt.y, 0);
+}
+
+//
+// Draw a single scrollbar inserted button, in whatever style
+// it has been defined to use.
+//
+static UINT DrawScrollButton(SCROLLBUT *sbut, HDC hdc, const RECT *pctrl, UINT flags)
+{
+ NMCSBCUSTOMDRAW nmcd;
+ HWND hwnd;
+ RECT rect = *pctrl;
+ UINT f;
+
+ switch(sbut->uButType & SBBT_MASK)
+ {
+ case SBBT_OWNERDRAW:
+
+ hwnd = WindowFromDC(hdc);
+
+ //fill in the standard header
+ nmcd.hdr.hwndFrom = hwnd;
+<<<<<<< .mine
+ nmcd.hdr.idFrom = GetWindowLongPtr(hwnd, GWL_ID);
+=======
+ nmcd.hdr.idFrom = GetWindowLongPtr(hwnd, GWLP_ID);
+>>>>>>> .r12533
+ nmcd.hdr.code = NM_COOLSB_CUSTOMDRAW;
+
+ nmcd.dwDrawStage = CDDS_ITEMPREPAINT;
+ nmcd.nBar = SB_INSBUT;
+ nmcd.rect = *pctrl;
+ nmcd.uItem = sbut->uCmdId;
+ nmcd.hdc = hdc;
+ nmcd.uState = flags;
+
+ IntersectClipRect(hdc, rect.left, rect.top, rect.right, rect.bottom);
+ SendMessage(GetParent(hwnd), WM_NOTIFY, nmcd.hdr.idFrom, (LPARAM)&nmcd);
+ SelectClipRgn(hdc, NULL);
+
+ break;
+
+ case SBBT_FIXED:
+ flags &= ~SBBS_PUSHED;
+
+ case SBBT_TOGGLEBUTTON:
+ if(sbut->uState != SBBS_NORMAL)
+ flags |= SBBS_PUSHED;
+
+ //intentionally fall through here...
+
+ case SBBT_PUSHBUTTON:
+
+ f = flags & SBBS_PUSHED ? DFCS_PUSHED | DFCS_FLAT : 0;
+ if(sbut->uButType & SBBM_LEFTARROW)
+ {
+ DrawFrameControl(hdc, &rect, DFC_SCROLL, DFCS_SCROLLLEFT | f);
+ }
+ else if(sbut->uButType & SBBM_RIGHTARROW)
+ {
+ DrawFrameControl(hdc, &rect, DFC_SCROLL, DFCS_SCROLLRIGHT | f);
+ }
+ else if(sbut->uButType & SBBM_UPARROW)
+ {
+ DrawFrameControl(hdc, &rect, DFC_SCROLL, DFCS_SCROLLUP | f);
+ }
+ else if(sbut->uButType & SBBM_DOWNARROW)
+ {
+ DrawFrameControl(hdc, &rect, DFC_SCROLL, DFCS_SCROLLDOWN | f);
+ }
+ else
+ {
+ //
+ if(flags & SBBS_PUSHED)
+ {
+ if(sbut->uButType & SBBM_RECESSED)
+ {
+ InflateRect(&rect, -1, -1);
+ DrawEdge(hdc, &rect, EDGE_SUNKEN, BF_RECT|BF_FLAT);
+ InflateRect(&rect, 1, 1);
+
+ FrameRect(hdc, &rect, GetSysColorBrush(COLOR_3DDKSHADOW));
+ InflateRect(&rect, -2, -2);
+ }
+ else
+ {
+ DrawEdge(hdc, &rect, EDGE_SUNKEN, BF_RECT | BF_FLAT | BF_ADJUST);
+ InflateRect(&rect, 1, 1);
+ }
+ }
+ else
+ {
+ // draw the button borders
+ if(sbut->uButType & SBBM_TYPE2)
+ {
+ DrawFrameControl(hdc, &rect, DFC_BUTTON, DFCS_BUTTONPUSH);
+ InflateRect(&rect, -2, -2);
+ }
+
+ else if(sbut->uButType & SBBM_TYPE3)
+ {
+ DrawFrameControl(hdc, &rect, DFC_BUTTON, DFCS_BUTTONPUSH);
+ InflateRect(&rect, -1, -1);
+ }
+ else
+ {
+ DrawEdge(hdc, &rect, EDGE_RAISED, BF_RECT | BF_ADJUST);
+ rect.bottom++;
+ rect.right++;
+ }
+
+ OffsetRect(&rect, -1, -1);
+ rect.top++; rect.left++;
+ }
+
+ if(sbut->hBmp)
+ {
+ PaintRect(hdc, &rect, GetSysColor(COLOR_3DFACE));
+
+ if(flags & SBBS_PUSHED)
+ {
+ rect.top++; rect.left++;
+ }
+
+ IntersectClipRect(hdc, rect.left, rect.top, rect.right,rect.bottom);
+ DrawImage(hdc, sbut->hBmp, &rect);
+ SelectClipRgn(hdc, 0);
+ }
+ else if(sbut->hEmf)
+ {
+ PaintRect(hdc, &rect, GetSysColor(COLOR_3DFACE));
+ InflateRect(&rect, -1, -1);
+
+ if(flags & SBBS_PUSHED)
+ {
+ rect.top++; rect.left++;
+ }
+
+ IntersectClipRect(hdc, rect.left, rect.top, rect.right,rect.bottom);
+ DrawMetaFile(hdc, sbut->hEmf, &rect);
+ SelectClipRgn(hdc, 0);
+ }
+ else
+ {
+ PaintRect(hdc, &rect, GetSysColor(COLOR_3DFACE));
+ }
+ }
+
+
+ break;
+
+ case SBBT_BLANK:
+ PaintRect(hdc, &rect, GetSysColor(COLOR_3DFACE));
+ break;
+
+ case SBBT_FLAT:
+ DrawBlankButton(hdc, &rect, BF_FLAT);
+ break;
+
+ case SBBT_DARK:
+ PaintRect(hdc, &rect, GetSysColor(COLOR_3DDKSHADOW));
+ break;
+ }
+
+ return 0;
+}
+
+//
+// Draw any buttons inserted into the horizontal scrollbar
+// assume that the button widths have already been calculated
+// Note: RECT *rect is the rectangle of the scrollbar
+// leftright: 1 = left, 2 = right, 3 = both
+//
+static LRESULT DrawHorzButtons(SCROLLBAR *sbar, HDC hdc, const RECT *rect, int leftright)
+{
+ int i;
+ int xposl, xposr;
+ RECT ctrl;
+ SCROLLBUT *sbut = sbar->sbButtons;
+
+ xposl = rect->left - sbar->nButSizeBefore;
+ xposr = rect->right;
+
+ for(i = 0; i < sbar->nButtons; i++)
+ {
+ if((leftright & SBBP_LEFT) && sbut[i].uPlacement == SBBP_LEFT)
+ {
+ int butwidth = GetSingleButSize(sbar, &sbut[i]);
+ SetRect(&ctrl, xposl, rect->top, xposl + butwidth, rect->bottom);
+ RotateRect0(sbar, &ctrl);
+ DrawScrollButton(&sbut[i], hdc, &ctrl, SBBS_NORMAL);
+
+ xposl += butwidth;
+ }
+
+ if((leftright & SBBP_RIGHT) && sbut[i].uPlacement == SBBP_RIGHT)
+ {
+ int butwidth = GetSingleButSize(sbar, &sbut[i]);
+ SetRect(&ctrl, xposr, rect->top, xposr + butwidth, rect->bottom);
+ RotateRect0(sbar, &ctrl);
+ DrawScrollButton(&sbut[i], hdc, &ctrl, SBBS_NORMAL);
+ xposr += butwidth;
+ }
+ }
+ return 0;
+}
+
+static LRESULT DrawVertButtons(SCROLLBAR *sbar, HDC hdc, const RECT *rect, int leftright)
+{
+ RECT rc = *rect;
+ RotateRect(&rc);
+ DrawHorzButtons(sbar, hdc, &rc, leftright);
+ return 0;
+}
+#endif // INCLUDE_BUTTONS
+
+//
+// Define these two for proper processing of NCPAINT
+// NOT needed if we don't bother to mask the scrollbars we draw
+// to prevent the old window procedure from accidently drawing over them
+//
+HDC CoolSB_GetDC(HWND hwnd, WPARAM wParam)
+{
+ // I just can't figure out GetDCEx, so I'll just use this:
+ return GetWindowDC(hwnd);
+
+ /*
+ RECT rc;
+ DWORD flags = 0x10000;
+ HRGN hrgn = (HRGN)wParam;
+
+ if(hrgn == (HRGN)1)
+ {
+ GetWindowRect(hwnd, &rc);
+ OffsetRect(&rc, -rc.left, -rc.top);
+ hrgn = CreateRectRgnIndirect(&rc);
+ }
+
+ if(GetWindowLongPtr(hwnd, GWL_STYLE) & WS_CLIPCHILDREN)
+ flags |= DCX_CLIPCHILDREN;
+
+ if(GetWindowLongPtr(hwnd, GWL_STYLE) & WS_CLIPSIBLINGS)
+ flags |= DCX_CLIPSIBLINGS;
+
+ return GetDCEx(hwnd, hrgn, flags | DCX_CACHE|DCX_NORESETATTRS|DCX_WINDOW | DCX_INTERSECTUPDATE);
+ */
+ //return GetDCEx(hwnd, NULL, flags | DCX_WINDOW| DCX_NORESETATTRS);
+}
+
+static LRESULT NCPaint(SCROLLWND *sw, HWND hwnd, WPARAM wParam, LPARAM lParam)
+{
+ SCROLLBAR *sb;
+ HDC hdc;
+ HRGN hrgn;
+ RECT winrect, rect;
+ HRGN clip = 0;
+ BOOL fUpdateAll = ((LONG)wParam == 1);
+ BOOL fCustomDraw = FALSE;
+ LRESULT ret;
+ DWORD dwStyle;
+
+ GetWindowRect(hwnd, &winrect);
+
+ //if entire region needs painting, then make a region to cover the entire window
+ if(fUpdateAll)
+ hrgn = (HRGN)wParam;
+ else
+ hrgn = (HRGN)wParam;
+
+ //hdc = GetWindowDC(hwnd);
+ hdc = CoolSB_GetDC(hwnd, wParam);
+
+ //
+ // Only draw the horizontal scrollbar if the window is tall enough
+ //
+ sb = &sw->sbarHorz;
+ if(sb->fScrollVisible)
+ {
+ int hbarwidth, leftright;
+
+ hbarwidth = leftright = 0;
+
+ //get the screen coordinates of the whole horizontal scrollbar area
+ GetHScrollRect(sw, hwnd, &rect);
+
+ //make the coordinates relative to the window for drawing
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+
+#ifdef INCLUDE_BUTTONS
+
+ //work out the size of any inserted buttons so we can dra them
+ sb->nButSizeBefore = GetButtonSize(sb, hwnd, SBBP_LEFT);
+ sb->nButSizeAfter = GetButtonSize(sb, hwnd, SBBP_RIGHT);
+
+ //make sure there is room for the buttons
+ hbarwidth = rect.right - rect.left;
+
+ //check that we can fit any left/right buttons in the available space
+ if(sb->nButSizeAfter < (hbarwidth - MIN_COOLSB_SIZE))
+ {
+ //adjust the scrollbar rectangle to fit the buttons into
+ sb->fButVisibleAfter = TRUE;
+ rect.right -= sb->nButSizeAfter;
+ leftright |= SBBP_RIGHT;
+
+ //check that there is enough space for the right buttons
+ if(sb->nButSizeBefore + sb->nButSizeAfter < (hbarwidth - MIN_COOLSB_SIZE))
+ {
+ sb->fButVisibleBefore = TRUE;
+ rect.left += sb->nButSizeBefore;
+ leftright |= SBBP_LEFT;
+ }
+ else
+ sb->fButVisibleBefore = FALSE;
+ }
+ else
+ sb->fButVisibleAfter = FALSE;
+
+
+ DrawHorzButtons(sb, hdc, &rect, leftright);
+#endif// INCLUDE_BUTTONS
+
+ if(uCurrentScrollbar == SB_HORZ)
+ fCustomDraw |= NCDrawHScrollbar(sb, hwnd, hdc, &rect, uScrollTimerPortion);
+ else
+ fCustomDraw |= NCDrawHScrollbar(sb, hwnd, hdc, &rect, HTSCROLL_NONE);
+ }
+
+ //
+ // Only draw the vertical scrollbar if the window is wide enough to accomodate it
+ //
+ sb = &sw->sbarVert;
+ if(sb->fScrollVisible)
+ {
+ int vbarheight;
+ vbarheight = 0;
+
+ //get the screen cooridinates of the whole horizontal scrollbar area
+ GetVScrollRect(sw, hwnd, &rect);
+
+ //make the coordinates relative to the window for drawing
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+
+#ifdef INCLUDE_BUTTONS
+
+ //work out the size of any inserted buttons so we can dra them
+ sb->nButSizeBefore = GetButtonSize(sb, hwnd, SBBP_LEFT);
+ sb->nButSizeAfter = GetButtonSize(sb, hwnd, SBBP_RIGHT);
+
+ //make sure there is room for the buttons
+ vbarheight = rect.bottom - rect.top;
+
+ //check that we can fit any left/right buttons in the available space
+ if(sb->nButSizeAfter < (vbarheight - MIN_COOLSB_SIZE))
+ {
+ //adjust the scrollbar rectangle to fit the buttons into
+ sb->fButVisibleAfter = TRUE;
+ rect.bottom -= sb->nButSizeAfter;
+ updown |= SBBP_BOTTOM;
+
+ //check that there is enough space for the right buttons
+ if(sb->nButSizeBefore + sb->nButSizeAfter < (vbarheight - MIN_COOLSB_SIZE))
+ {
+ sb->fButVisibleBefore = TRUE;
+ rect.top += sb->nButSizeBefore;
+ updown |= SBBP_TOP;
+ }
+ else
+ sb->fButVisibleBefore = FALSE;
+ }
+ else
+ sb->fButVisibleAfter = FALSE;
+
+
+ DrawVertButtons(sb, hdc, &rect, updown);
+#endif // INCLUDE_BUTTONS
+
+ if(uCurrentScrollbar == SB_VERT)
+ fCustomDraw |= NCDrawVScrollbar(sb, hwnd, hdc, &rect, uScrollTimerPortion);
+ else
+ fCustomDraw |= NCDrawVScrollbar(sb, hwnd, hdc, &rect, HTSCROLL_NONE);
+ }
+
+ //Call the default window procedure for WM_NCPAINT, with the
+ //new window region. ** region must be in SCREEN coordinates **
+ dwStyle = GetWindowLong(hwnd, GWL_STYLE);
+
+ // If the window has WS_(H-V)SCROLL bits set, we should reset them
+ // to avoid windows taking the scrollbars into account.
+ // We temporarily set a flag preventing the subsecuent
+ // WM_STYLECHANGING/WM_STYLECHANGED to be forwarded to
+ // the original window procedure
+ if ( dwStyle & (WS_VSCROLL|WS_HSCROLL) )
+ {
+ sw->bPreventStyleChange = TRUE;
+ SetWindowLong(hwnd, GWL_STYLE, dwStyle & ~(WS_VSCROLL|WS_HSCROLL));
+ }
+
+ ret = CallWindowProc(sw->oldproc, hwnd, WM_NCPAINT, (WPARAM)hrgn, lParam);
+
+ if ( dwStyle & (WS_VSCROLL|WS_HSCROLL) )
+ {
+ SetWindowLong(hwnd, GWL_STYLE, dwStyle);
+ sw->bPreventStyleChange = FALSE;
+ }
+
+
+ // DRAW THE DEAD AREA
+ // only do this if the horizontal and vertical bars are visible
+ if(sw->sbarHorz.fScrollVisible && sw->sbarVert.fScrollVisible)
+ {
+ GetWindowRect(hwnd, &rect);
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+
+ rect.bottom -= sw->cyBottomEdge;
+ rect.top = rect.bottom - GetScrollMetric(&sw->sbarHorz, SM_CYHORZSB);
+
+ if(sw->fLeftScrollbar)
+ {
+ rect.left += sw->cxLeftEdge;
+ rect.right = rect.left + GetScrollMetric(&sw->sbarVert, SM_CXVERTSB);
+ }
+ else
+ {
+ rect.right -= sw->cxRightEdge;
+ rect.left = rect.right - GetScrollMetric(&sw->sbarVert, SM_CXVERTSB);
+ }
+
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, SB_BOTH, &rect, 32, 0, 0, 0);
+ else
+ {
+ //calculate the position of THIS window's dead area
+ //with the position of the PARENT window's client rectangle.
+ //if THIS window has been positioned such that its bottom-right
+ //corner sits in the parent's bottom-right corner, then we should
+ //show the sizing-grip.
+ //Otherwise, assume this window is not in the right place, and
+ //just draw a blank rectangle
+ RECT parent;
+ RECT rect2;
+ HWND hwndParent = GetParent(hwnd);
+
+ GetClientRect(hwndParent, &parent);
+ MapWindowPoints(hwndParent, 0, (POINT *)&parent, 2);
+
+ CopyRect(&rect2, &rect);
+ OffsetRect(&rect2, winrect.left, winrect.top);
+
+ if(!sw->fLeftScrollbar && parent.right == rect2.right+sw->cxRightEdge && parent.bottom == rect2.bottom+sw->cyBottomEdge
+ || sw->fLeftScrollbar && parent.left == rect2.left -sw->cxLeftEdge && parent.bottom == rect2.bottom+sw->cyBottomEdge)
+ DrawFrameControl(hdc, &rect, DFC_SCROLL, sw->fLeftScrollbar ? DFCS_SCROLLSIZEGRIPRIGHT : DFCS_SCROLLSIZEGRIP );
+ else
+ PaintRect(hdc, &rect, GetSysColor(COLOR_3DFACE));
+ }
+ }
+
+ UNREFERENCED_PARAMETER(clip);
+ ReleaseDC(hwnd, hdc);
+ return ret;
+}
+
+//
+// Need to detect if we have clicked in the scrollbar region or not
+//
+static LRESULT NCHitTest(SCROLLWND *sw, HWND hwnd, WPARAM wParam, LPARAM lParam)
+{
+ RECT hrect;
+ RECT vrect;
+ POINT pt;
+
+ pt.x = LOWORD(lParam);
+ pt.y = HIWORD(lParam);
+
+ //work out exactly where the Horizontal and Vertical scrollbars are
+ GetHScrollRect(sw, hwnd, &hrect);
+ GetVScrollRect(sw, hwnd, &vrect);
+
+ //Clicked in the horizontal scrollbar area
+ if(sw->sbarHorz.fScrollVisible && PtInRect(&hrect, pt))
+ {
+ return HTHSCROLL;
+ }
+ //Clicked in the vertical scrollbar area
+ else if(sw->sbarVert.fScrollVisible && PtInRect(&vrect, pt))
+ {
+ return HTVSCROLL;
+ }
+ //clicked somewhere else
+ else
+ {
+ return CallWindowProc(sw->oldproc, hwnd, WM_NCHITTEST, wParam, lParam);
+ }
+}
+
+//
+// Return a HT* value indicating what part of the scrollbar was clicked
+// Rectangle is not adjusted
+//
+static UINT GetHorzPortion(SCROLLBAR *sb, HWND hwnd, RECT *rect, int x, int y)
+{
+ RECT rc = *rect;
+
+ if(y < rc.top || y >= rc.bottom) return HTSCROLL_NONE;
+
+#ifdef INCLUDE_BUTTONS
+
+ if(sb->fButVisibleBefore)
+ {
+ //clicked on the buttons to the left of the scrollbar
+ if(x >= rc.left && x < rc.left + sb->nButSizeBefore)
+ return HTSCROLL_INSERTED;
+
+ //adjust the rectangle to exclude the left-side buttons, now that we
+ //know we havn't clicked on them
+ rc.left += sb->nButSizeBefore;
+ }
+
+ if(sb->fButVisibleAfter)
+ {
+ //clicked on the buttons to the right of the scrollbar
+ if(x >= rc.right - sb->nButSizeAfter && x < rc.right)
+ return HTSCROLL_INSERTED;
+
+ //adjust the rectangle to exclude the right-side buttons, now that we
+ //know we havn't clicked on them
+ rc.right -= sb->nButSizeAfter;
+ }
+
+#endif INCLUDE_BUTTONS
+
+ //Now we have the rectangle for the scrollbar itself, so work out
+ //what part we clicked on.
+ return GetHorzScrollPortion(sb, hwnd, &rc, x, y);
+}
+
+//
+// Just call the horizontal version, with adjusted coordinates
+//
+static UINT GetVertPortion(SCROLLBAR *sb, HWND hwnd, RECT *rect, int x, int y)
+{
+ UINT ret;
+ RotateRect(rect);
+ ret = GetHorzPortion(sb, hwnd, rect, y, x);
+ RotateRect(rect);
+ return ret;
+}
+
+//
+// Wrapper function for GetHorzPortion and GetVertPortion
+//
+static UINT GetPortion(SCROLLBAR *sb, HWND hwnd, RECT *rect, int x, int y)
+{
+ if(sb->nBarType == SB_HORZ)
+ return GetHorzPortion(sb, hwnd, rect, x, y);
+ else if(sb->nBarType == SB_VERT)
+ return GetVertPortion(sb, hwnd, rect, x, y);
+ else
+ return HTSCROLL_NONE;
+}
+
+//
+// Input: rectangle of the total scrollbar area
+// Output: adjusted to take the inserted buttons into account
+//
+static void GetRealHorzScrollRect(SCROLLBAR *sb, RECT *rect)
+{
+ if(sb->fButVisibleBefore) rect->left += sb->nButSizeBefore;
+ if(sb->fButVisibleAfter) rect->right -= sb->nButSizeAfter;
+}
+
+//
+// Input: rectangle of the total scrollbar area
+// Output: adjusted to take the inserted buttons into account
+//
+static void GetRealVertScrollRect(SCROLLBAR *sb, RECT *rect)
+{
+ if(sb->fButVisibleBefore) rect->top += sb->nButSizeBefore;
+ if(sb->fButVisibleAfter) rect->bottom -= sb->nButSizeAfter;
+}
+
+//
+// Decide which type of scrollbar we have before calling
+// the real function to do the job
+//
+static void GetRealScrollRect(SCROLLBAR *sb, RECT *rect)
+{
+ if(sb->nBarType == SB_HORZ)
+ {
+ GetRealHorzScrollRect(sb, rect);
+ }
+ else if(sb->nBarType == SB_VERT)
+ {
+ GetRealVertScrollRect(sb, rect);
+ }
+}
+
+//
+// All button code shoule be collected together
+//
+//
+#ifdef INCLUDE_BUTTONS
+
+//
+// Return the index of the button covering the specified point
+// rect - rectangle of the whole scrollbar area
+// pt - screen coords of the mouse
+// fReturnRect - do/don't modify the rect to return the button's area
+//
+static UINT GetHorzButtonFromPt(SCROLLBAR *sb, RECT *rect, POINT pt, BOOL fReturnRect)
+{
+ int leftpos = rect->left, rightpos = rect->right;
+ int i;
+ int butwidth;
+ SCROLLBUT *sbut = sb->sbButtons;
+
+ if(!PtInRect(rect, pt))
+ return -1;
+
+ if(sb->fButVisibleAfter)
+ rightpos -= sb->nButSizeAfter;
+
+ for(i = 0; i < sb->nButtons; i++)
+ {
+ if(sb->fButVisibleBefore && sbut[i].uPlacement == SBBP_LEFT)
+ {
+ butwidth = GetSingleButSize(sb, &sbut[i]);
+
+ //if the current button is under the specified point
+ if(pt.x >= leftpos && pt.x < leftpos + butwidth)
+ {
+ //if the caller wants us to return the rectangle of the button
+ if(fReturnRect)
+ {
+ rect->left = leftpos;
+ rect->right = leftpos + butwidth;
+ }
+
+ return i;
+ }
+
+ leftpos += butwidth;
+ }
+ else if(sb->fButVisibleAfter && sbut[i].uPlacement == SBBP_RIGHT)
+ {
+ butwidth = GetSingleButSize(sb, &sbut[i]);
+
+ //if the current button is under the specified point
+ if(pt.x >= rightpos && pt.x < rightpos + butwidth)
+ {
+ //if the caller wants us to return the rectangle of the button
+ if(fReturnRect)
+ {
+ rect->left = rightpos;
+ rect->right = rightpos + butwidth;
+ }
+ return i;
+ }
+
+ rightpos += butwidth;
+ }
+ }
+
+ return -1;
+}
+
+
+static UINT GetVertButtonFromPt(SCROLLBAR *sb, RECT *rect, POINT pt, BOOL fReturnRect)
+{
+ UINT ret;
+ int temp;
+
+ //swap the X/Y coords
+ temp = pt.x;
+ pt.x = pt.y;
+ pt.y = temp;
+
+ //swap the rectangle
+ RotateRect(rect);
+
+ ret = GetHorzButtonFromPt(sb, rect, pt, fReturnRect);
+
+ RotateRect(rect);
+ return ret;
+}
+
+//
+//
+//
+static UINT GetButtonFromPt(SCROLLBAR *sb, RECT *rect, POINT pt, BOOL fReturnRect)
+{
+ if(sb->nBarType == SB_HORZ)
+ {
+ return GetHorzButtonFromPt(sb, rect, pt, fReturnRect);
+ }
+ else
+ {
+ return GetVertButtonFromPt(sb, rect, pt, fReturnRect);
+ }
+}
+
+//
+// Find the coordinates (in RECT format) of the specified button index
+//
+static UINT GetHorzButtonRectFromId(SCROLLBAR *sb, RECT *rect, UINT index)
+{
+ UINT i;
+ SCROLLBUT *sbut = sb->sbButtons;
+ int leftpos = rect->left, rightpos = rect->right;
+
+ if(sb->fButVisibleAfter)
+ rightpos -= sb->nButSizeAfter;
+
+ //find the particular button in question
+ for(i = 0; i < index; i++)
+ {
+ if(sb->fButVisibleBefore && sbut[i].uPlacement == SBBP_LEFT)
+ {
+ leftpos += GetSingleButSize(sb, &sbut[i]);
+ }
+ else if(sb->fButVisibleAfter && sbut[i].uPlacement == SBBP_RIGHT)
+ {
+ rightpos += GetSingleButSize(sb, &sbut[i]);
+ }
+ }
+
+ //now return the rectangle
+ if(sbut[i].uPlacement == SBBP_LEFT)
+ {
+ rect->left = leftpos;
+ rect->right = leftpos + GetSingleButSize(sb, &sbut[i]);
+ }
+ else
+ {
+ rect->left = rightpos;
+ rect->right = rightpos + GetSingleButSize(sb, &sbut[i]);
+ }
+
+ return 0;
+}
+
+static UINT GetVertButtonRectFromId(SCROLLBAR *sb, RECT *rect, UINT index)
+{
+ UINT ret;
+ RotateRect(rect);
+ ret = GetHorzButtonRectFromId(sb, rect, index);
+ RotateRect(rect);
+ return ret;
+}
+
+static UINT GetButtonRectFromId(SCROLLBAR *sb, RECT *rect, UINT index)
+{
+ if(sb->nBarType == SB_HORZ)
+ {
+ return GetHorzButtonRectFromId(sb, rect, index);
+ }
+ else
+ {
+ return GetVertButtonRectFromId(sb, rect, index);
+ }
+}
+#endif //INCLUDE_BUTTONS
+
+//
+// Left button click in the non-client area
+//
+static LRESULT NCLButtonDown(SCROLLWND *sw, HWND hwnd, WPARAM wParam, LPARAM lParam)
+{
+ RECT rect, winrect;
+ HDC hdc;
+ SCROLLBAR *sb;
+ SCROLLBUT *sbut;
+ POINT pt;
+
+ sbut = 0;
+
+ pt.x = LOWORD(lParam);
+ pt.y = HIWORD(lParam);
+
+ hwndCurCoolSB = hwnd;
+
+ //
+ // HORIZONTAL SCROLLBAR PROCESSING
+ //
+ if(wParam == HTHSCROLL)
+ {
+ uScrollTimerMsg = WM_HSCROLL;
+ uCurrentScrollbar = SB_HORZ;
+ sb = &sw->sbarHorz;
+
+ //get the total area of the normal Horz scrollbar area
+ GetHScrollRect(sw, hwnd, &rect);
+ uCurrentScrollPortion = GetHorzPortion(sb, hwnd, &rect, LOWORD(lParam), HIWORD(lParam));
+ }
+ //
+ // VERTICAL SCROLLBAR PROCESSING
+ //
+ else if(wParam == HTVSCROLL)
+ {
+ uScrollTimerMsg = WM_VSCROLL;
+ uCurrentScrollbar = SB_VERT;
+ sb = &sw->sbarVert;
+
+ //get the total area of the normal Horz scrollbar area
+ GetVScrollRect(sw, hwnd, &rect);
+ uCurrentScrollPortion = GetVertPortion(sb, hwnd, &rect, LOWORD(lParam), HIWORD(lParam));
+ }
+ //
+ // NORMAL PROCESSING
+ //
+ else
+ {
+ uCurrentScrollPortion = HTSCROLL_NONE;
+ return CallWindowProc(sw->oldproc, hwnd, WM_NCLBUTTONDOWN, wParam, lParam);
+ }
+
+ //
+ // we can now share the same code for vertical
+ // and horizontal scrollbars
+ //
+ switch(uCurrentScrollPortion)
+ {
+ //inserted buttons to the left/right
+#ifdef INCLUDE_BUTTONS
+ case HTSCROLL_INSERTED:
+
+#ifdef HOT_TRACKING
+ KillTimer(hwnd, uMouseOverId);
+ uMouseOverId = 0;
+ uMouseOverScrollbar = COOLSB_NONE;
+#endif
+
+ //find the index of the button that has been clicked
+ //adjust the rectangle to give the button's rectangle
+ uCurrentButton = GetButtonFromPt(sb, &rect, pt, TRUE);
+
+ sbut = &sb->sbButtons[uCurrentButton];
+
+ //post a notification message
+ PostMouseNotify(hwnd, NM_CLICK, sb->nBarType, &rect, sbut->uCmdId, pt);
+
+ GetWindowRect(hwnd, &winrect);
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+ hdc = GetWindowDC(hwnd);
+
+ DrawScrollButton(sbut, hdc, &rect, SBBS_PUSHED);
+
+ ReleaseDC(hwnd, hdc);
+
+ break;
+#endif //INCLUDE_BUTTONS
+
+ case HTSCROLL_THUMB:
+
+ //if the scrollbar is disabled, then do no further processing
+ if(!IsScrollbarActive(sb))
+ return 0;
+
+ GetRealScrollRect(sb, &rect);
+ RotateRect0(sb, &rect);
+ CalcThumbSize(sb, &rect, &nThumbSize, &nThumbPos);
+ RotateRect0(sb, &rect);
+
+ //remember the bounding rectangle of the scrollbar work area
+ rcThumbBounds = rect;
+
+ sw->fThumbTracking = TRUE;
+ sb->scrollInfo.nTrackPos = sb->scrollInfo.nPos;
+
+ if(wParam == HTVSCROLL)
+ nThumbMouseOffset = pt.y - nThumbPos;
+ else
+ nThumbMouseOffset = pt.x - nThumbPos;
+
+ nLastPos = -sb->scrollInfo.nPos;
+ nThumbPos0 = nThumbPos;
+
+ //if(sb->fFlatScrollbar)
+ //{
+ GetWindowRect(hwnd, &winrect);
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+ hdc = GetWindowDC(hwnd);
+ NCDrawScrollbar(sb, hwnd, hdc, &rect, HTSCROLL_THUMB);
+ ReleaseDC(hwnd, hdc);
+ //}
+
+ break;
+
+ //Any part of the scrollbar
+ case HTSCROLL_LEFT:
+ if(sb->fScrollFlags & ESB_DISABLE_LEFT) return 0;
+ else goto target1;
+
+ case HTSCROLL_RIGHT:
+ if(sb->fScrollFlags & ESB_DISABLE_RIGHT) return 0;
+ else goto target1;
+
+ goto target1;
+
+ case HTSCROLL_PAGELEFT: case HTSCROLL_PAGERIGHT:
+
+ target1:
+
+ //if the scrollbar is disabled, then do no further processing
+ if(!IsScrollbarActive(sb))
+ break;
+
+ //ajust the horizontal rectangle to NOT include
+ //any inserted buttons
+ GetRealScrollRect(sb, &rect);
+
+ SendScrollMessage(hwnd, uScrollTimerMsg, uCurrentScrollPortion, 0);
+
+ // Check what area the mouse is now over :
+ // If the scroll thumb has moved under the mouse in response to
+ // a call to SetScrollPos etc, then we don't hilight the scrollbar margin
+ if(uCurrentScrollbar == SB_HORZ)
+ uScrollTimerPortion = GetHorzScrollPortion(sb, hwnd, &rect, pt.x, pt.y);
+ else
+ uScrollTimerPortion = GetVertScrollPortion(sb, hwnd, &rect, pt.x, pt.y);
+
+ GetWindowRect(hwnd, &winrect);
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+ hdc = GetWindowDC(hwnd);
+
+#ifndef HOT_TRACKING
+ //if we aren't hot-tracking, then don't highlight
+ //the scrollbar thumb unless we click on it
+ if(uScrollTimerPortion == HTSCROLL_THUMB)
+ uScrollTimerPortion = HTSCROLL_NONE;
+#endif
+ NCDrawScrollbar(sb, hwnd, hdc, &rect, uScrollTimerPortion);
+ ReleaseDC(hwnd, hdc);
+
+ //Post the scroll message!!!!
+ uScrollTimerPortion = uCurrentScrollPortion;
+
+ //set a timer going on the first click.
+ //if this one expires, then we can start off a more regular timer
+ //to generate the auto-scroll behaviour
+ uScrollTimerId = SetTimer(hwnd, COOLSB_TIMERID1, COOLSB_TIMERINTERVAL1, 0);
+ break;
+ default:
+ return CallWindowProc(sw->oldproc, hwnd, WM_NCLBUTTONDOWN, wParam, lParam);
+ //return 0;
+ }
+
+ SetCapture(hwnd);
+ return 0;
+}
+
+//
+// Left button released
+//
+static LRESULT LButtonUp(SCROLLWND *sw, HWND hwnd, WPARAM wParam, LPARAM lParam)
+{
+ RECT rect;
+ //UINT thisportion;
+ HDC hdc;
+ POINT pt;
+ RECT winrect;
+
+ //current scrollportion is the button that we clicked down on
+ if(uCurrentScrollPortion != HTSCROLL_NONE)
+ {
+ SCROLLBAR *sb = &sw->sbarHorz;
+ lParam = GetMessagePos();
+ ReleaseCapture();
+
+ GetWindowRect(hwnd, &winrect);
+ pt.x = LOWORD(lParam);
+ pt.y = HIWORD(lParam);
+
+ //emulate the mouse input on a scrollbar here...
+ if(uCurrentScrollbar == SB_HORZ)
+ {
+ //get the total area of the normal Horz scrollbar area
+ sb = &sw->sbarHorz;
+ GetHScrollRect(sw, hwnd, &rect);
+ }
+ else if(uCurrentScrollbar == SB_VERT)
+ {
+ //get the total area of the normal Horz scrollbar area
+ sb = &sw->sbarVert;
+ GetVScrollRect(sw, hwnd, &rect);
+ }
+
+ //we need to do different things depending on if the
+ //user is activating the scrollbar itself, or one of
+ //the inserted buttons
+ switch(uCurrentScrollPortion)
+ {
+#ifdef INCLUDE_BUTTONS
+ //inserted buttons are being clicked
+ case HTSCROLL_INSERTED:
+
+ //get the rectangle of the ACTIVE button
+ buttonIdx = GetButtonFromPt(sb, &rect, pt, FALSE);
+ GetButtonRectFromId(sb, &rect, uCurrentButton);
+
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+
+ //Send the notification BEFORE we redraw, so the
+ //bitmap can be changed smoothly by the user if they require
+ if(uCurrentButton == buttonIdx)
+ {
+ SCROLLBUT *sbut = &sb->sbButtons[buttonIdx];
+ UINT cmdid = sbut->uCmdId;
+
+ if((sbut->uButType & SBBT_MASK) == SBBT_TOGGLEBUTTON)
+ sbut->uState ^= 1;
+
+ //send a notify??
+ //only post a message if the command id is valid
+ if(cmdid != -1 && cmdid > 0)
+ SendMessage(hwnd, WM_COMMAND, MAKEWPARAM(cmdid, CSBN_CLICKED), 0);
+
+ //user might have deleted this button, so redraw whole area
+ NCPaint(sw, hwnd, 1, 0);
+ }
+ else
+ {
+ //otherwise, just redraw the button in its new state
+ hdc = GetWindowDC(hwnd);
+ DrawScrollButton(&sb->sbButtons[uCurrentButton], hdc, &rect, SBBS_NORMAL);
+ ReleaseDC(hwnd, hdc);
+ }
+
+ break;
+#endif // INCLUDE_BUTTONS
+
+ //The scrollbar is active
+ case HTSCROLL_LEFT: case HTSCROLL_RIGHT:
+ case HTSCROLL_PAGELEFT: case HTSCROLL_PAGERIGHT:
+ case HTSCROLL_NONE:
+
+ KillTimer(hwnd, uScrollTimerId);
+
+ case HTSCROLL_THUMB:
+
+ //In case we were thumb tracking, make sure we stop NOW
+ if(sw->fThumbTracking == TRUE)
+ {
+ SendScrollMessage(hwnd, uScrollTimerMsg, SB_THUMBPOSITION, nLastPos);
+ sw->fThumbTracking = FALSE;
+ }
+
+ //send the SB_ENDSCROLL message now that scrolling has finished
+ SendScrollMessage(hwnd, uScrollTimerMsg, SB_ENDSCROLL, 0);
+
+ //adjust the total scroll area to become where the scrollbar
+ //really is (take into account the inserted buttons)
+ GetRealScrollRect(sb, &rect);
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+ hdc = GetWindowDC(hwnd);
+
+ //draw whichever scrollbar sb is
+ NCDrawScrollbar(sb, hwnd, hdc, &rect, HTSCROLL_NORMAL);
+
+ ReleaseDC(hwnd, hdc);
+ break;
+ }
+
+ //reset our state to default
+ uCurrentScrollPortion = HTSCROLL_NONE;
+ uScrollTimerPortion = HTSCROLL_NONE;
+ uScrollTimerId = 0;
+
+ uScrollTimerMsg = 0;
+ uCurrentScrollbar = COOLSB_NONE;
+
+ return 0;
+ }
+ else
+ {
+ /*
+ // Can't remember why I did this!
+ if(GetCapture() == hwnd)
+ {
+ ReleaseCapture();
+ }*/
+ }
+
+ return CallWindowProc(sw->oldproc, hwnd, WM_LBUTTONUP, wParam, lParam);
+}
+
+//
+// This function is called whenever the mouse is moved and
+// we are dragging the scrollbar thumb about.
+//
+static LRESULT ThumbTrackHorz(SCROLLBAR *sbar, HWND hwnd, int x, int y)
+{
+ POINT pt;
+ RECT rc, winrect, rc2;
+ COLORREF crCheck1 = GetSBForeColor();
+ COLORREF crCheck2 = GetSBBackColor();
+ HDC hdc;
+ int thumbpos = nThumbPos;
+ int pos;
+ int siMaxMin = 0;
+ UINT flatflag = sbar->fFlatScrollbar ? BF_FLAT : 0;
+ BOOL fCustomDraw = FALSE;
+
+ SCROLLINFO *si;
+ si = &sbar->scrollInfo;
+
+ pt.x = x;
+ pt.y = y;
+
+ //draw the thumb at whatever position
+ rc = rcThumbBounds;
+
+ SetRect(&rc2, rc.left - THUMBTRACK_SNAPDIST*2, rc.top - THUMBTRACK_SNAPDIST,
+ rc.right + THUMBTRACK_SNAPDIST*2, rc.bottom + THUMBTRACK_SNAPDIST);
+
+ rc.left += GetScrollMetric(sbar, SM_CXHORZSB);
+ rc.right -= GetScrollMetric(sbar, SM_CXHORZSB);
+
+ //if the mouse is not in a suitable distance of the scrollbar,
+ //then "snap" the thumb back to its initial position
+#ifdef SNAP_THUMB_BACK
+ if(!PtInRect(&rc2, pt))
+ {
+ thumbpos = nThumbPos0;
+ }
+ //otherwise, move the thumb to where the mouse is
+ else
+#endif //SNAP_THUMB_BACK
+ {
+ //keep the thumb within the scrollbar limits
+ thumbpos = pt.x - nThumbMouseOffset;
+ if(thumbpos < rc.left) thumbpos = rc.left;
+ if(thumbpos > rc.right - nThumbSize) thumbpos = rc.right - nThumbSize;
+ }
+
+ GetWindowRect(hwnd, &winrect);
+
+ if(sbar->nBarType == SB_VERT)
+ RotateRect(&winrect);
+
+ hdc = GetWindowDC(hwnd);
+
+//#ifdef CUSTOM_DRAW
+ fCustomDraw = PostCustomPrePostPaint(hwnd, hdc, sbar, CDDS_PREPAINT) == CDRF_SKIPDEFAULT;
+//#endif
+
+ OffsetRect(&rc, -winrect.left, -winrect.top);
+ thumbpos -= winrect.left;
+
+ //draw the margin before the thumb
+ SetRect(&rc2, rc.left, rc.top, thumbpos, rc.bottom);
+ RotateRect0(sbar, &rc2);
+
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sbar->nBarType, &rc2, SB_PAGELEFT, 0, 0, 0);
+ else
+ DrawCheckedRect(hdc, &rc2, crCheck1, crCheck2);
+
+ RotateRect0(sbar, &rc2);
+
+ //draw the margin after the thumb
+ SetRect(&rc2, thumbpos+nThumbSize, rc.top, rc.right, rc.bottom);
+
+ RotateRect0(sbar, &rc2);
+
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sbar->nBarType, &rc2, SB_PAGERIGHT, 0, 0, 0);
+ else
+ DrawCheckedRect(hdc, &rc2, crCheck1, crCheck2);
+
+ RotateRect0(sbar, &rc2);
+
+ //finally draw the thumb itelf. This is how it looks on win2000, anyway
+ SetRect(&rc2, thumbpos, rc.top, thumbpos+nThumbSize, rc.bottom);
+
+ RotateRect0(sbar, &rc2);
+
+ if(fCustomDraw)
+ PostCustomDrawNotify(hwnd, hdc, sbar->nBarType, &rc2, SB_THUMBTRACK, TRUE, TRUE, FALSE);
+ else
+ {
+
+#ifdef FLAT_SCROLLBARS
+ if(sbar->fFlatScrollbar)
+ PaintRect(hdc, &rc2, GetSysColor(COLOR_3DSHADOW));
+ else
+#endif
+ {
+ DrawBlankButton(hdc, &rc2, flatflag);
+ }
+ }
+
+ RotateRect0(sbar, &rc2);
+ ReleaseDC(hwnd, hdc);
+
+ //post a SB_TRACKPOS message!!!
+ siMaxMin = si->nMax - si->nMin;
+
+ if(siMaxMin > 0)
+ pos = MulDiv(thumbpos-rc.left, siMaxMin-si->nPage + 1, rc.right-rc.left-nThumbSize);
+ else
+ pos = thumbpos - rc.left;
+
+ if(pos != nLastPos)
+ {
+ si->nTrackPos = pos;
+ SendScrollMessage(hwnd, uScrollTimerMsg, SB_THUMBTRACK, pos);
+ }
+
+ nLastPos = pos;
+
+//#ifdef CUSTOM_DRAW
+ PostCustomPrePostPaint(hwnd, hdc, sbar, CDDS_POSTPAINT);
+//#endif
+
+ return 0;
+}
+
+//
+// remember to rotate the thumb bounds rectangle!!
+//
+static LRESULT ThumbTrackVert(SCROLLBAR *sb, HWND hwnd, int x, int y)
+{
+ //sw->swapcoords = TRUE;
+ RotateRect(&rcThumbBounds);
+ ThumbTrackHorz(sb, hwnd, y, x);
+ RotateRect(&rcThumbBounds);
+ //sw->swapcoords = FALSE;
+
+ return 0;
+}
+
+//
+// Called when we have set the capture from the NCLButtonDown(...)
+//
+static LRESULT MouseMove(SCROLLWND *sw, HWND hwnd, WPARAM wParam, LPARAM lParam)
+{
+ RECT rect;
+ UINT thisportion;
+ HDC hdc;
+ static UINT lastportion = 0;
+ static UINT lastbutton = 0;
+ POINT pt;
+ RECT winrect;
+ UINT buttonIdx = 0;
+
+ if(sw->fThumbTracking == TRUE)
+ {
+ int x, y;
+ lParam = GetMessagePos();
+ x = LOWORD(lParam);
+ y = HIWORD(lParam);
+
+ if(uCurrentScrollbar == SB_HORZ)
+ return ThumbTrackHorz(&sw->sbarHorz, hwnd, x,y);
+
+
+ else if(uCurrentScrollbar == SB_VERT)
+ return ThumbTrackVert(&sw->sbarVert, hwnd, x,y);
+ }
+
+ if(uCurrentScrollPortion == HTSCROLL_NONE)
+ {
+ return CallWindowProc(sw->oldproc, hwnd, WM_MOUSEMOVE, wParam, lParam);
+ }
+ else
+ {
+ LPARAM nlParam;
+ SCROLLBAR *sb = &sw->sbarHorz;
+ SCROLLBUT *sbut;
+
+ sbut = 0;
+
+ nlParam = GetMessagePos();
+
+ GetWindowRect(hwnd, &winrect);
+
+ pt.x = LOWORD(nlParam);
+ pt.y = HIWORD(nlParam);
+
+ //emulate the mouse input on a scrollbar here...
+ if(uCurrentScrollbar == SB_HORZ)
+ {
+ sb = &sw->sbarHorz;
+ }
+ else if(uCurrentScrollbar == SB_VERT)
+ {
+ sb = &sw->sbarVert;
+ }
+
+ //get the total area of the normal scrollbar area
+ GetScrollRect(sw, sb->nBarType, hwnd, &rect);
+
+ //see if we clicked in the inserted buttons / normal scrollbar
+ //thisportion = GetPortion(sb, hwnd, &rect, LOWORD(lParam), HIWORD(lParam));
+ thisportion = GetPortion(sb, hwnd, &rect, pt.x, pt.y);
+
+ //we need to do different things depending on if the
+ //user is activating the scrollbar itself, or one of
+ //the inserted buttons
+ switch(uCurrentScrollPortion)
+ {
+#ifdef INCLUDE_BUTTONS
+ //inserted buttons are being clicked
+ case HTSCROLL_INSERTED:
+
+ //find the index of the button that has been clicked
+ //Don't adjust the rectangle though
+ buttonIdx = GetButtonFromPt(sb, &rect, pt, FALSE);
+
+ //Get the rectangle of the active button
+ GetButtonRectFromId(sb, &rect, uCurrentButton);
+
+ //if the button to the LEFT of the current
+ //button is resizable, then resize it
+#ifdef RESIZABLE_BUTTONS
+ if(uCurrentButton > 0)
+ {
+ sbut = &sb->sbButtons[uCurrentButton - 1];
+
+ //only resize if BOTH buttons are on same side of scrollbar
+ if(sbut->uPlacement == (sbut+1)->uPlacement && (sbut->uButType & SBBM_RESIZABLE))
+ {
+ int oldsize = sbut->nSize;
+ int butsize1, butsize2;
+ RECT rect2;
+ int scrollsize;
+
+ if(uCurrentScrollbar == SB_HORZ)
+ {
+ rect.left -= GetSingleButSize(sb, sbut);
+ sbut->nSize = pt.x - rect.left;
+ }
+ else
+ {
+ rect.top -= GetSingleButSize(sb, sbut);
+ sbut->nSize = pt.y - rect.top;
+ }
+
+ //if(sbut->nSize < 0) sbut->nSize = 0;
+ if(sbut->nSize < (int)sbut->nMinSize)
+ sbut->nSize = sbut->nMinSize;
+
+ if((UINT)sbut->nSize > (UINT)sbut->nMaxSize)
+ sbut->nSize = sbut->nMaxSize;
+
+ GetScrollRect(sw, uCurrentScrollbar, hwnd, &rect2);
+
+ if(uCurrentScrollbar == SB_HORZ)
+ scrollsize = rect2.right-rect2.left;
+ else
+ scrollsize = rect2.bottom-rect2.top;
+
+ butsize1 = GetButtonSize(sb, hwnd, SBBP_LEFT);
+ butsize2 = GetButtonSize(sb, hwnd, SBBP_RIGHT);
+
+ //adjust the button size if it gets too big
+ if(butsize1 + butsize2 > scrollsize - MINSCROLLSIZE)
+ {
+ sbut->nSize -= (butsize1+butsize2) - (scrollsize - MINSCROLLSIZE);
+ }
+
+ //remember what size the USER set the button to
+ sbut->nSizeReserved = sbut->nSize;
+ NCPaint(sw, hwnd, (WPARAM)1, (LPARAM)0);
+ return 0;
+ }
+ }
+#endif //RESIZABLE_BUTTONS
+
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+
+ hdc = GetWindowDC(hwnd);
+
+ //if the button under the mouse is not the active button,
+ //then display the active button in its normal state
+ if(buttonIdx != uCurrentButton
+ //include this if toggle buttons always stay depressed
+ //if they are being activated
+ && (sb->sbButtons[uCurrentButton].uButType & SBBT_MASK) != SBBT_TOGGLEBUTTON)
+ {
+ if(lastbutton != buttonIdx)
+ DrawScrollButton(&sb->sbButtons[uCurrentButton], hdc, &rect, SBBS_NORMAL);
+ }
+ //otherwise, depress the active button if the mouse is over
+ //it (just like a normal scroll button works)
+ else
+ {
+ if(lastbutton != buttonIdx)
+ DrawScrollButton(&sb->sbButtons[uCurrentButton], hdc, &rect, SBBS_PUSHED);
+ }
+
+ ReleaseDC(hwnd, hdc);
+ return CallWindowProc(sw->oldproc, hwnd, WM_MOUSEMOVE, wParam, lParam);
+ //break;
+
+#endif //INCLUDE_BUTTONS
+
+ //The scrollbar is active
+ case HTSCROLL_LEFT: case HTSCROLL_RIGHT:case HTSCROLL_THUMB:
+ case HTSCROLL_PAGELEFT: case HTSCROLL_PAGERIGHT:
+ case HTSCROLL_NONE:
+
+ //adjust the total scroll area to become where the scrollbar
+ //really is (take into account the inserted buttons)
+ GetRealScrollRect(sb, &rect);
+
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+ hdc = GetWindowDC(hwnd);
+
+ if(thisportion != uCurrentScrollPortion)
+ {
+ uScrollTimerPortion = HTSCROLL_NONE;
+
+ if(lastportion != thisportion)
+ NCDrawScrollbar(sb, hwnd, hdc, &rect, HTSCROLL_NORMAL);
+ }
+ //otherwise, draw the button in its depressed / clicked state
+ else
+ {
+ uScrollTimerPortion = uCurrentScrollPortion;
+
+ if(lastportion != thisportion)
+ NCDrawScrollbar(sb, hwnd, hdc, &rect, thisportion);
+ }
+
+ ReleaseDC(hwnd, hdc);
+
+ break;
+ }
+
+
+ lastportion = thisportion;
+ lastbutton = buttonIdx;
+
+ //must return zero here, because we might get cursor anomilies
+ //CallWindowProc(sw->oldproc, hwnd, WM_MOUSEMOVE, wParam, lParam);
+ return 0;
+
+ }
+}
+
+#ifdef INCLUDE_BUTTONS
+#ifdef RESIZABLE_BUTTONS
+//
+// Any resizable buttons must be shrunk to fit if the window is made too small
+//
+static void ResizeButtonsToFit(SCROLLWND *sw, SCROLLBAR *sbar, HWND hwnd)
+{
+ int butsize1, butsize2;
+ RECT rc;
+ int scrollsize;
+ int i;
+ SCROLLBUT *sbut;
+
+ //make sure that the scrollbar can fit into space, by
+ //shrinking any resizable buttons
+ GetScrollRect(sw, sbar->nBarType, hwnd, &rc);
+
+ if(sbar->nBarType == SB_HORZ)
+ scrollsize = rc.right-rc.left;
+ else
+ scrollsize = rc.bottom-rc.top;
+
+ //restore any resizable buttons to their user-defined sizes,
+ //before shrinking them to fit. This means when we make the window
+ //bigger, the buttons will restore to their initial sizes
+ for(i = 0; i < sbar->nButtons; i++)
+ {
+ sbut = &sbar->sbButtons[i];
+ if(sbut->uButType & SBBM_RESIZABLE)
+ {
+ sbut->nSize = sbut->nSizeReserved;
+ }
+ }
+
+ butsize1 = GetButtonSize(sbar, hwnd, SBBP_LEFT);
+ butsize2 = GetButtonSize(sbar, hwnd, SBBP_RIGHT);
+
+ if(butsize1 + butsize2 > scrollsize - MINSCROLLSIZE)
+ {
+ i = 0;
+ while(i < sbar->nButtons &&
+ butsize1 + butsize2 > scrollsize - MINSCROLLSIZE)
+ {
+ sbut = &sbar->sbButtons[i++];
+ if(sbut->uButType & SBBM_RESIZABLE)
+ {
+ int oldsize = sbut->nSize;
+ sbut->nSize -= (butsize1+butsize2) - (scrollsize-MINSCROLLSIZE);
+
+ if(sbut->nSize < (int)sbut->nMinSize)
+ sbut->nSize = sbut->nMinSize;
+
+ if((UINT)sbut->nSize > (UINT)sbut->nMaxSize)
+ sbut->nSize = sbut->nMaxSize;
+
+
+ butsize1 -= (oldsize - sbut->nSize);
+ }
+ }
+ }
+
+}
+#endif
+#endif
+
+//
+// We must allocate from in the non-client area for our scrollbars
+// Call the default window procedure first, to get the borders (if any)
+// allocated some space, then allocate the space for the scrollbars
+// if they fit
+//
+static LRESULT NCCalcSize(SCROLLWND *sw, HWND hwnd, WPARAM wParam, LPARAM lParam)
+{
+ NCCALCSIZE_PARAMS *nccsp;
+ RECT *rect;
+ RECT oldrect;
+ SCROLLBAR *sb;
+ LRESULT ret;
+ DWORD dwStyle;
+
+ //Regardless of the value of fCalcValidRects, the first rectangle
+ //in the array specified by the rgrc structure member of the
+ //NCCALCSIZE_PARAMS structure contains the coordinates of the window,
+ //so we can use the exact same code to modify this rectangle, when
+ //wParam is TRUE and when it is FALSE.
+ nccsp = (NCCALCSIZE_PARAMS *)lParam;
+ rect = &nccsp->rgrc[0];
+ oldrect = *rect;
+
+ dwStyle = GetWindowLong(hwnd, GWL_STYLE);
+
+ // TURN OFF SCROLL-STYLES.
+ if ( dwStyle & (WS_VSCROLL|WS_HSCROLL) )
+ {
+ sw->bPreventStyleChange = TRUE;
+ SetWindowLong(hwnd, GWL_STYLE, dwStyle & ~(WS_VSCROLL|WS_HSCROLL));
+ }
+
+ //call the default procedure to get the borders allocated
+ ret = CallWindowProc(sw->oldproc, hwnd, WM_NCCALCSIZE, wParam, lParam);
+
+ // RESTORE PREVIOUS STYLES (if present at all)
+ if ( dwStyle & (WS_VSCROLL|WS_HSCROLL) )
+ {
+ SetWindowLong(hwnd, GWL_STYLE, dwStyle);
+ sw->bPreventStyleChange = FALSE;
+ }
+
+ // calculate what the size of each window border is,
+ sw->cxLeftEdge = rect->left - oldrect.left;
+ sw->cxRightEdge = oldrect.right - rect->right;
+ sw->cyTopEdge = rect->top - oldrect.top;
+ sw->cyBottomEdge = oldrect.bottom - rect->bottom;
+
+ sb = &sw->sbarHorz;
+
+ //if there is room, allocate some space for the horizontal scrollbar
+ //NOTE: Change the ">" to a ">=" to make the horz bar totally fill the
+ //window before disappearing
+ if((sb->fScrollFlags & CSBS_VISIBLE) &&
+#ifdef COOLSB_FILLWINDOW
+ rect->bottom - rect->top >= GetScrollMetric(sb, SM_CYHORZSB))
+#else
+ rect->bottom - rect->top > GetScrollMetric(sb, SM_CYHORZSB))
+#endif
+ {
+ rect->bottom -= GetScrollMetric(sb, SM_CYHORZSB);
+ sb->fScrollVisible = TRUE;
+ }
+ else
+ sb->fScrollVisible = FALSE;
+
+ sb = &sw->sbarVert;
+
+ //if there is room, allocate some space for the vertical scrollbar
+ if((sb->fScrollFlags & CSBS_VISIBLE) &&
+ rect->right - rect->left >= GetScrollMetric(sb, SM_CXVERTSB))
+ {
+ if(sw->fLeftScrollbar)
+ rect->left += GetScrollMetric(sb, SM_CXVERTSB);
+ else
+ rect->right -= GetScrollMetric(sb, SM_CXVERTSB);
+
+ sb->fScrollVisible = TRUE;
+ }
+ else
+ sb->fScrollVisible = FALSE;
+
+#ifdef INCLUDE_BUTTONS
+#ifdef RESIZABLE_BUTTONS
+ ResizeButtonsToFit(sw, &sw->sbarHorz, hwnd);
+ ResizeButtonsToFit(sw, &sw->sbarVert, hwnd);
+#endif
+#endif
+
+ //don't return a value unless we actually modify the other rectangles
+ //in the NCCALCSIZE_PARAMS structure. In this case, we return 0
+ //no matter what the value of fCalcValidRects is
+ return ret;//FALSE;
+}
+
+//
+// used for hot-tracking over the scroll buttons
+//
+static LRESULT NCMouseMove(SCROLLWND *sw, HWND hwnd, WPARAM wHitTest, LPARAM lParam)
+{
+ //install a timer for the mouse-over events, if the mouse moves
+ //over one of the scrollbars
+#ifdef HOT_TRACKING
+ hwndCurCoolSB = hwnd;
+ if(wHitTest == HTHSCROLL)
+ {
+ if(uMouseOverScrollbar == SB_HORZ)
+ return CallWindowProc(sw->oldproc, hwnd, WM_NCMOUSEMOVE, wHitTest, lParam);
+
+ uLastHitTestPortion = HTSCROLL_NONE;
+ uHitTestPortion = HTSCROLL_NONE;
+ GetScrollRect(sw, SB_HORZ, hwnd, &MouseOverRect);
+ uMouseOverScrollbar = SB_HORZ;
+ uMouseOverId = SetTimer(hwnd, COOLSB_TIMERID3, COOLSB_TIMERINTERVAL3, 0);
+
+ NCPaint(sw, hwnd, 1, 0);
+ }
+ else if(wHitTest == HTVSCROLL)
+ {
+ if(uMouseOverScrollbar == SB_VERT)
+ return CallWindowProc(sw->oldproc, hwnd, WM_NCMOUSEMOVE, wHitTest, lParam);
+
+ uLastHitTestPortion = HTSCROLL_NONE;
+ uHitTestPortion = HTSCROLL_NONE;
+ GetScrollRect(sw, SB_VERT, hwnd, &MouseOverRect);
+ uMouseOverScrollbar = SB_VERT;
+ uMouseOverId = SetTimer(hwnd, COOLSB_TIMERID3, COOLSB_TIMERINTERVAL3, 0);
+
+ NCPaint(sw, hwnd, 1, 0);
+ }
+
+#endif //HOT_TRACKING
+ return CallWindowProc(sw->oldproc, hwnd, WM_NCMOUSEMOVE, wHitTest, lParam);
+}
+
+//
+// Timer routine to generate scrollbar messages
+//
+static LRESULT CoolSB_Timer(SCROLLWND *swnd, HWND hwnd, WPARAM wTimerId, LPARAM lParam)
+{
+ //let all timer messages go past if we don't have a timer installed ourselves
+ if(uScrollTimerId == 0 && uMouseOverId == 0)
+ {
+ return CallWindowProc(swnd->oldproc, hwnd, WM_TIMER, wTimerId, lParam);
+ }
+
+#ifdef HOT_TRACKING
+ //mouse-over timer
+ if(wTimerId == COOLSB_TIMERID3)
+ {
+ POINT pt;
+ RECT rect, winrect;
+ HDC hdc;
+ SCROLLBAR *sbar;
+
+ if(swnd->fThumbTracking)
+ return 0;
+
+ //if the mouse moves outside the current scrollbar,
+ //then kill the timer..
+ GetCursorPos(&pt);
+
+ if(!PtInRect(&MouseOverRect, pt))
+ {
+ KillTimer(hwnd, uMouseOverId);
+ uMouseOverId = 0;
+ uMouseOverScrollbar = COOLSB_NONE;
+ uLastHitTestPortion = HTSCROLL_NONE;
+
+ uHitTestPortion = HTSCROLL_NONE;
+ NCPaint(swnd, hwnd, 1, 0);
+ }
+ else
+ {
+ if(uMouseOverScrollbar == SB_HORZ)
+ {
+ sbar = &swnd->sbarHorz;
+ uHitTestPortion = GetHorzPortion(sbar, hwnd, &MouseOverRect, pt.x, pt.y);
+ }
+ else
+ {
+ sbar = &swnd->sbarVert;
+ uHitTestPortion = GetVertPortion(sbar, hwnd, &MouseOverRect, pt.x, pt.y);
+ }
+
+ if(uLastHitTestPortion != uHitTestPortion)
+ {
+ rect = MouseOverRect;
+ GetRealScrollRect(sbar, &rect);
+
+ GetWindowRect(hwnd, &winrect);
+ OffsetRect(&rect, -winrect.left, -winrect.top);
+
+ hdc = GetWindowDC(hwnd);
+ NCDrawScrollbar(sbar, hwnd, hdc, &rect, HTSCROLL_NONE);
+ ReleaseDC(hwnd, hdc);
+ }
+
+ uLastHitTestPortion = uHitTestPortion;
+ }
+
+ return 0;
+ }
+#endif // HOT_TRACKING
+
+ //if the first timer goes off, then we can start a more
+ //regular timer interval to auto-generate scroll messages
+ //this gives a slight pause between first pressing the scroll arrow, and the
+ //actual scroll starting
+ if(wTimerId == COOLSB_TIMERID1)
+ {
+ KillTimer(hwnd, uScrollTimerId);
+ uScrollTimerId = SetTimer(hwnd, COOLSB_TIMERID2, COOLSB_TIMERINTERVAL2, 0);
+ return 0;
+ }
+ //send the scrollbar message repeatedly
+ else if(wTimerId == COOLSB_TIMERID2)
+ {
+ //need to process a spoof WM_MOUSEMOVE, so that
+ //we know where the mouse is each time the scroll timer goes off.
+ //This is so we can stop sending scroll messages if the thumb moves
+ //under the mouse.
+ POINT pt;
+ GetCursorPos(&pt);
+ ScreenToClient(hwnd, &pt);
+
+ MouseMove(swnd, hwnd, MK_LBUTTON, MAKELPARAM(pt.x, pt.y));
+
+ if(uScrollTimerPortion != HTSCROLL_NONE)
+ SendScrollMessage(hwnd, uScrollTimerMsg, uScrollTimerPortion, 0);
+
+ return 0;
+ }
+ else
+ {
+ return CallWindowProc(swnd->oldproc, hwnd, WM_TIMER, wTimerId, lParam);
+ }
+}
+
+//
+// We must intercept any calls to SetWindowLong, to check if
+// left-scrollbars are taking effect or not
+//
+static LRESULT CoolSB_StyleChange(SCROLLWND *swnd, HWND hwnd, UINT msg, WPARAM wParam, LPARAM lParam)
+{
+ STYLESTRUCT *ss = (STYLESTRUCT *)lParam;
+
+ if(wParam == GWL_EXSTYLE)
+ {
+ if(ss->styleNew & WS_EX_LEFTSCROLLBAR)
+ swnd->fLeftScrollbar = TRUE;
+ else
+ swnd->fLeftScrollbar = FALSE;
+ }
+
+ return CallWindowProc(swnd->oldproc, hwnd, msg, wParam, lParam);
+}
+
+static UINT curTool = -1;
+static LRESULT CoolSB_Notify(SCROLLWND *swnd, HWND hwnd, WPARAM wParam, LPARAM lParam)
+{
+#ifdef COOLSB_TOOLTIPS
+
+ NMTTDISPINFO *nmdi = (NMTTDISPINFO *)lParam;
+
+ if(nmdi->hdr.hwndFrom == swnd->hwndToolTip &&
+ nmdi->hdr.code == TTN_GETDISPINFO)
+ {
+ //convert the tooltip notify from a "ISHWND" style
+ //request to an id-based request.
+ //We do this because our tooltip is a window-style
+ //tip, with no tools, and the GETDISPINFO request must
+ //indicate which button to retrieve the text for
+ //nmdi->hdr.idFrom = curTool;
+ nmdi->hdr.idFrom = curTool;
+ nmdi->hinst = GetModuleHandle(0);
+ nmdi->uFlags &= ~TTF_IDISHWND;
+ }
+#endif //COOLSB_TOOLTIPS
+
+ return CallWindowProc(swnd->oldproc, hwnd, WM_NOTIFY, wParam, lParam);
+}
+
+static LRESULT SendToolTipMessage0(HWND hwndTT, UINT message, WPARAM wParam, LPARAM lParam)
+{
+ return SendMessage(hwndTT, message, wParam, lParam);
+}
+
+#ifdef COOLSB_TOOLTIPS
+#define SendToolTipMessage SendToolTipMessage0
+#else
+#define SendToolTipMessage 1 ? (void)0 : SendToolTipMessage0
+#endif
+
+
+//
+// We must intercept any calls to SetWindowLong, to make sure that
+// the user does not set the WS_VSCROLL or WS_HSCROLL styles
+//
+static LRESULT CoolSB_SetCursor(SCROLLWND *swnd, HWND hwnd, WPARAM wParam, LPARAM lParam)
+{
+#ifdef INCLUDE_BUTTONS
+ UINT lo = LOWORD(lParam);
+ UINT hi = HIWORD(lParam);
+ UINT xy;
+ RECT rect;
+ SCROLLBAR *sbar;
+ SCROLLBUT *sbut;
+ POINT pt;
+ UINT id;
+ static UINT lastid;
+
+#ifdef HIDE_CURSOR_AFTER_MOUSEUP
+ static UINT lastmsg;
+ if(lastmsg == WM_LBUTTONDOWN)
+ {
+ lastmsg = hi;
+ return CallWindowProc(swnd->oldproc, hwnd, WM_SETCURSOR, wParam, lParam);
+ }
+ else
+ lastmsg = hi;
+#endif
+
+ //if we are over either or our scrollbars
+ if(lo == HTHSCROLL || lo == HTVSCROLL)
+ {
+ xy = GetMessagePos();
+ pt.x = LOWORD(xy);
+ pt.y = HIWORD(xy);
+
+ if(lo == HTHSCROLL)
+ {
+ sbar = &swnd->sbarHorz;
+ GetScrollRect(swnd, SB_HORZ, hwnd, &rect);
+ id = GetHorzPortion(sbar, hwnd, &rect, pt.x, pt.y);
+ }
+ else
+ {
+ sbar = &swnd->sbarVert;
+ GetScrollRect(swnd, SB_VERT, hwnd, &rect);
+ id = GetVertPortion(sbar, hwnd, &rect, pt.x, pt.y);
+ }
+
+ if(id != HTSCROLL_INSERTED)
+ {
+ if(swnd->hwndToolTip != 0)
+ {
+ SendToolTipMessage(swnd->hwndToolTip, TTM_ACTIVATE, FALSE, 0);
+ SendToolTipMessage(swnd->hwndToolTip, TTM_POP, 0, 0);
+ }
+
+ return CallWindowProc(swnd->oldproc, hwnd, WM_SETCURSOR, wParam, lParam);
+ }
+
+ if(swnd->hwndToolTip != 0)
+ {
+ SendToolTipMessage(swnd->hwndToolTip, TTM_ACTIVATE, TRUE, 0);
+ }
+
+ //set the cursor if one has been specified
+ if((id = GetButtonFromPt(sbar, &rect, pt, TRUE)) != -1)
+ {
+ sbut = &sbar->sbButtons[id];
+ curTool = sbut->uCmdId;
+
+ if(lastid != id && swnd->hwndToolTip != 0)
+ {
+ if(IsWindowVisible(swnd->hwndToolTip))
+ SendToolTipMessage(swnd->hwndToolTip, TTM_UPDATE, TRUE, 0);
+ }
+
+ lastid = id;
+
+ if(sbut->hCurs != 0)
+ {
+ SetCursor(sbut->hCurs);
+ return 0;
+ }
+ }
+ else
+ {
+ curTool = -1;
+ lastid = -1;
+ }
+ }
+ else if(swnd->hwndToolTip != 0)
+ {
+ SendToolTipMessage(swnd->hwndToolTip, TTM_ACTIVATE, FALSE, 0);
+ SendToolTipMessage(swnd->hwndToolTip, TTM_POP, 0, 0);
+ }
+
+#endif //INCLUDE_BUTTONS
+ return CallWindowProc(swnd->oldproc, hwnd, WM_SETCURSOR, wParam, lParam);
+}
+
+
+//
+// Send the specified message to the tooltip control
+//
+static void __stdcall RelayMouseEvent(HWND hwnd, HWND hwndToolTip, UINT event)
+{
+#ifdef COOLSB_TOOLTIPS
+ MSG msg;
+
+ CoolSB_ZeroMemory(&msg, sizeof(MSG));
+ msg.hwnd = hwnd;
+ msg.message = event;
+
+ SendMessage(hwndToolTip, TTM_RELAYEVENT, 0, (LONG)&msg);
+#else
+ UNREFERENCED_PARAMETER(hwnd);
+ UNREFERENCED_PARAMETER(hwndToolTip);
+ UNREFERENCED_PARAMETER(event);
+#endif
+}
+
+
+//
+// CoolScrollbar subclass procedure.
+// Handle all messages needed to mimick normal windows scrollbars
+//
+LRESULT CALLBACK CoolSBWndProc(HWND hwnd, UINT message, WPARAM wParam, LPARAM lParam)
+{
+ WNDPROC oldproc;
+ SCROLLWND *swnd = GetScrollWndFromHwnd(hwnd);
+ static int count;
+
+ switch(message)
+ {
+ case WM_NCDESTROY:
+ //this should NEVER be called, because the user
+ //should have called Uninitialize() themselves.
+
+ //However, if the user tries to call Uninitialize()..
+ //after this window is destroyed, this window's entry in the lookup
+ //table will not be there, and the call will fail
+ oldproc = swnd->oldproc;
+ UninitializeCoolSB(hwnd);
+
+ //we must call the original window procedure, otherwise it
+ //will never get the WM_NCDESTROY message, and it wouldn't
+ //be able to clean up etc.
+ return CallWindowProc(oldproc, hwnd, message, wParam, lParam);
+
+ case WM_NCCALCSIZE:
+ return NCCalcSize(swnd, hwnd, wParam, lParam);
+
+ case WM_NCPAINT:
+ return NCPaint(swnd, hwnd, wParam, lParam);
+
+ case WM_NCHITTEST:
+ return NCHitTest(swnd, hwnd, wParam, lParam);
+
+ case WM_NCRBUTTONDOWN: case WM_NCRBUTTONUP:
+ case WM_NCMBUTTONDOWN: case WM_NCMBUTTONUP:
+ RelayMouseEvent(hwnd, swnd->hwndToolTip, (WM_MOUSEMOVE-WM_NCMOUSEMOVE) + (message));
+ if(wParam == HTHSCROLL || wParam == HTVSCROLL)
+ return 0;
+ else
+ break;
+
+ case WM_NCLBUTTONDBLCLK:
+ //TRACE("WM_NCLBUTTONDBLCLK %d\n", count++);
+ if(wParam == HTHSCROLL || wParam == HTVSCROLL)
+ return NCLButtonDown(swnd, hwnd, wParam, lParam);
+ else
+ break;
+
+ case WM_NCLBUTTONDOWN:
+ //TRACE("WM_NCLBUTTONDOWN%d\n", count++);
+ RelayMouseEvent(hwnd, swnd->hwndToolTip, WM_LBUTTONDOWN);
+ return NCLButtonDown(swnd, hwnd, wParam, lParam);
+
+
+ case WM_LBUTTONUP:
+ //TRACE("WM_LBUTTONUP %d\n", count++);
+ RelayMouseEvent(hwnd, swnd->hwndToolTip, WM_LBUTTONUP);
+ return LButtonUp(swnd, hwnd, wParam, lParam);
+
+ case WM_NOTIFY:
+ return CoolSB_Notify(swnd, hwnd, wParam, lParam);
+
+ //Mouse moves are received when we set the mouse capture,
+ //even when the mouse moves over the non-client area
+ case WM_MOUSEMOVE:
+ //TRACE("WM_MOUSEMOVE %d\n", count++);
+ return MouseMove(swnd, hwnd, wParam, lParam);
+
+ case WM_TIMER:
+ return CoolSB_Timer(swnd, hwnd, wParam, lParam);
+
+ //case WM_STYLECHANGING:
+ // return CoolSB_StyleChange(swnd, hwnd, WM_STYLECHANGING, wParam, lParam);
+ case WM_STYLECHANGED:
+
+ if(swnd->bPreventStyleChange)
+ {
+ // the NCPAINT handler has told us to eat this message!
+ return 0;
+ }
+ else
+ {
+ if (message == WM_STYLECHANGED)
+ return CoolSB_StyleChange(swnd, hwnd, WM_STYLECHANGED, wParam, lParam);
+ else
+ break;
+ }
+
+ case WM_NCMOUSEMOVE:
+ {
+ static LONG_PTR lastpos = -1;
+
+ //TRACE("WM_NCMOUSEMOVE %d\n", count++);
+
+ //The problem with NCMOUSEMOVE is that it is sent continuously
+ //even when the mouse is stationary (under win2000 / win98)
+ //
+ //Tooltips don't like being sent a continous stream of mouse-moves
+ //if the cursor isn't moving, because they will think that the mouse
+ //is moving position, and the internal timer will never expire
+ //
+ if(lastpos != lParam)
+ {
+ RelayMouseEvent(hwnd, swnd->hwndToolTip, WM_MOUSEMOVE);
+ lastpos = lParam;
+ }
+ }
+
+ return NCMouseMove(swnd, hwnd, wParam, lParam);
+
+
+ case WM_SETCURSOR:
+ return CoolSB_SetCursor(swnd, hwnd, wParam, lParam);
+
+ case WM_CAPTURECHANGED:
+ break;
+
+ default:
+ break;
+ }
+
+ return CallWindowProc(swnd->oldproc, hwnd, message, wParam, lParam);
+}
+
diff --git a/plugins/Clist_ng/coolsb/coolscroll.h b/plugins/Clist_ng/coolsb/coolscroll.h new file mode 100644 index 0000000000..c5fe848a83 --- /dev/null +++ b/plugins/Clist_ng/coolsb/coolscroll.h @@ -0,0 +1,232 @@ +#ifndef _COOLSBLIB_INCLUDED
+#define _COOLSBLIB_INCLUDED
+
+#ifdef __cplusplus
+extern "C"{
+#endif
+
+#include <windows.h>
+#include <win2k.h>
+
+// To complement the exisiting SB_HORZ, SB_VERT, SB_BOTH
+// scrollbar identifiers
+#define COOLSB_NONE (-1)
+#define SB_INSBUT (-2)
+
+//
+// Arrow size defines
+//
+#define SYSTEM_METRIC (-1)
+
+
+//
+// general scrollbar styles
+//
+// use the standard ESB_DISABLE_xxx flags to represent the
+// enabled / disabled states. (defined in winuser.h)
+//
+#define CSBS_THUMBALWAYS 4
+#define CSBS_VISIBLE 8
+
+//cool scrollbar styles for Flat scrollbars
+#define CSBS_NORMAL 0
+#define CSBS_FLAT 1
+#define CSBS_HOTTRACKED 2
+
+//
+// Button mask flags for indicating which members of SCROLLBUT
+// to use during a button insertion / modification
+//
+#define SBBF_TYPE 0x0001
+#define SBBF_ID 0x0002
+#define SBBF_PLACEMENT 0x0004
+#define SBBF_SIZE 0x0008
+#define SBBF_BITMAP 0x0010
+#define SBBF_ENHMETAFILE 0x0020
+//#define SBBF_OWNERDRAW 0x0040 //unused at present
+#define SBBF_CURSOR 0x0080
+#define SBBF_BUTMINMAX 0x0100
+#define SBBF_STATE 0x0200
+
+//button styles (states)
+#define SBBS_NORMAL 0
+#define SBBS_PUSHED 1
+#define SBBS_CHECKED SBBS_PUSHED
+
+//
+// scrollbar button types
+//
+#define SBBT_PUSHBUTTON 1 //standard push button
+#define SBBT_TOGGLEBUTTON 2 //toggle button
+#define SBBT_FIXED 3 //fixed button (non-clickable)
+#define SBBT_FLAT 4 //blank area (flat, with border)
+#define SBBT_BLANK 5 //blank area (flat, no border)
+#define SBBT_DARK 6 //dark blank area (flat)
+#define SBBT_OWNERDRAW 7 //user draws the button via a WM_NOTIFY
+
+#define SBBT_MASK 0x1f //mask off low 5 bits
+
+//button type modifiers
+#define SBBM_RECESSED 0x0020 //recessed when clicked (like Word 97)
+#define SBBM_LEFTARROW 0x0040
+#define SBBM_RIGHTARROW 0x0080
+#define SBBM_UPARROW 0x0100
+#define SBBM_DOWNARROW 0x0200
+#define SBBM_RESIZABLE 0x0400
+#define SBBM_TYPE2 0x0800
+#define SBBM_TYPE3 0x1000
+#define SBBM_TOOLTIPS 0x2000 //currently unused (define COOLSB_TOOLTIPS in userdefs.h)
+
+//button placement flags
+#define SBBP_LEFT 1
+#define SBBP_RIGHT 2
+#define SBBP_TOP 1 //3
+#define SBBP_BOTTOM 2 //4
+
+
+//
+// Button command notification codes
+// for sending with a WM_COMMAND message
+//
+#define CSBN_BASE 0
+#define CSBN_CLICKED (1 + CSBN_BASE)
+#define CSBN_HILIGHT (2 + CSBN_BASE)
+
+//
+// Minimum size in pixels of a scrollbar thumb
+//
+#define MINTHUMBSIZE_NT4 8
+#define MINTHUMBSIZE_2000 6
+
+//define some more hittest values for our cool-scrollbar
+#define HTSCROLL_LEFT (SB_LINELEFT)
+#define HTSCROLL_RIGHT (SB_LINERIGHT)
+#define HTSCROLL_UP (SB_LINEUP)
+#define HTSCROLL_DOWN (SB_LINEDOWN)
+#define HTSCROLL_THUMB (SB_THUMBTRACK)
+#define HTSCROLL_PAGEGUP (SB_PAGEUP)
+#define HTSCROLL_PAGEGDOWN (SB_PAGEDOWN)
+#define HTSCROLL_PAGELEFT (SB_PAGELEFT)
+#define HTSCROLL_PAGERIGHT (SB_PAGERIGHT)
+
+#define HTSCROLL_NONE (-1)
+#define HTSCROLL_NORMAL (-1)
+
+#define HTSCROLL_INSERTED (128)
+#define HTSCROLL_PRE (32 | HTSCROLL_INSERTED)
+#define HTSCROLL_POST (64 | HTSCROLL_INSERTED)
+
+/*
+
+ Public interface to the Cool Scrollbar library
+
+
+*/
+
+BOOL WINAPI InitializeCoolSB(HWND hwnd);
+HRESULT WINAPI UninitializeCoolSB (HWND hwnd);
+
+BOOL WINAPI CoolSB_SetMinThumbSize(HWND hwnd, UINT wBar, UINT size);
+BOOL WINAPI CoolSB_IsThumbTracking(HWND hwnd);
+BOOL WINAPI CoolSB_IsCoolScrollEnabled(HWND hwnd);
+
+//
+BOOL WINAPI CoolSB_EnableScrollBar (HWND hwnd, int wSBflags, UINT wArrows);
+BOOL WINAPI CoolSB_GetScrollInfo (HWND hwnd, int fnBar, LPSCROLLINFO lpsi);
+int WINAPI CoolSB_GetScrollPos (HWND hwnd, int nBar);
+BOOL WINAPI CoolSB_GetScrollRange (HWND hwnd, int nBar, LPINT lpMinPos, LPINT lpMaxPos);
+
+//
+int WINAPI CoolSB_SetScrollInfo (HWND hwnd, int fnBar, LPSCROLLINFO lpsi, BOOL fRedraw);
+int WINAPI CoolSB_SetScrollPos (HWND hwnd, int nBar, int nPos, BOOL fRedraw);
+int WINAPI CoolSB_SetScrollRange (HWND hwnd, int nBar, int nMinPos, int nMaxPos, BOOL fRedraw);
+BOOL WINAPI CoolSB_ShowScrollBar (HWND hwnd, int wBar, BOOL fShow);
+
+//
+// Scrollbar dimension functions
+//
+BOOL WINAPI CoolSB_SetSize (HWND hwnd, int wBar, int nLength, int nWidth);
+
+//
+// Set the visual nature of a scrollbar (flat, normal etc)
+//
+BOOL WINAPI CoolSB_SetStyle (HWND hwnd, int wBar, UINT nStyle);
+BOOL WINAPI CoolSB_SetThumbAlways (HWND hwnd, int wBar, BOOL fThumbAlways);
+
+//
+// Scrollbar button structure, for inserted buttons only
+//
+typedef struct
+{
+ UINT fMask; //which members are in use
+ UINT uPlacement; //is this button to the left/right (above/below) of the scrollbar??
+ UINT uCmdId; //command identifier (WM_COMMAND value to send)
+ UINT uButType; //
+ UINT uState; //toggled etc
+ int nSize; //size in pixels. -1 for autosize
+
+ HBITMAP hBmp; //handle to a bitmap to use as the button face
+ HENHMETAFILE hEmf; //handle to an enhanced metafile
+
+ HCURSOR hCurs; //handle to a user-supplied mouse cursor to apply
+ //to this button
+
+ int nSizeReserved; //internal variable used for resizing
+ int nMinSize; //min size
+ int nMaxSize; //max size
+
+} SCROLLBUT;
+
+BOOL WINAPI CoolSB_InsertButton(HWND hwnd, int wSBflags, UINT nPos, SCROLLBUT *psb);
+BOOL WINAPI CoolSB_ModifyButton(HWND hwnd, int wSBflags, UINT uItem, BOOL fByCmd, SCROLLBUT *psb);
+BOOL WINAPI CoolSB_RemoveButton(HWND hwnd, int wSBflags, UINT uItem, BOOL fByCmd);
+BOOL WINAPI CoolSB_GetButton (HWND hwnd, int wSBflags, UINT uItem, BOOL fByCmd, SCROLLBUT *psb);
+
+void WINAPI CoolSB_SetESBProc(void *proc);
+
+typedef struct
+{
+ NMHDR hdr;
+ DWORD dwDrawStage;
+ HDC hdc;
+ RECT rect;
+ UINT uItem;
+ UINT uState;
+ UINT nBar;
+
+} NMCSBCUSTOMDRAW;
+
+typedef struct
+{
+ NMHDR hdr;
+ RECT rect;
+ POINT pt;
+ UINT uCmdId;
+ UINT uState;
+ int nBar;
+} NMCOOLBUTMSG;
+
+/*
+typedef struct
+{
+ NMHDR hdr;
+ DWORD dwDrawStage;
+ HDC hdc;
+ RECT rect;
+ UINT uCmdId;
+ UINT uState;
+
+} NMCOOLBUTTON_CUSTOMDRAW;
+*/
+
+
+//
+// Define the WM_NOTIFY code value for cool-scrollbar custom drawing
+//
+#define NM_COOLSB_CUSTOMDRAW (0-0xfffU)
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif
diff --git a/plugins/Clist_ng/coolsb/userdefs.h b/plugins/Clist_ng/coolsb/userdefs.h new file mode 100644 index 0000000000..ea7ea1fe92 --- /dev/null +++ b/plugins/Clist_ng/coolsb/userdefs.h @@ -0,0 +1,79 @@ +#ifndef _USERDEFINES_INCLUDED
+#define _USERDEFINES_INCLUDED
+
+/*
+
+ Define these values to alter the various
+ features of the coolscroll library. If you don't want
+ a certain feature, then you might be able to reduce the
+ size of your app by a few kb...
+
+*/
+
+/* allow inserted buttons. Without this, all button code will
+ be excluded, resulting in a smaller build (about 4kb less). This
+ may not seem much, but it is a 25% reduction! */
+//#define INCLUDE_BUTTONS
+
+/* Allow user-resizable buttons. Makes no difference if INCLUDE_BUTTONS
+ is not defined for the project */
+#define RESIZABLE_BUTTONS
+
+/* Include tooltip support for inserted buttons. Without this, no
+ tooltip requests (TTN_GETDISPINFO's) will be sent to the window */
+//#define COOLSB_TOOLTIPS
+
+/* Define this to include the custom-draw support */
+#define CUSTOM_DRAW
+
+/* Define to enable WM_NOTIFY messages to be sent for mouse event */
+#define NOTIFY_MOUSE
+
+/* Define this value to make the horizontal scrollbar stay visible even
+ if the window is sized to small vertically. Normal scrollbars always leave
+ a 1-pixel line of "client" area before hiding the horizontal scrollbar. This
+ value allows the window to be sized so the client area totally disappears if
+ sized too small */
+//#define COOLSB_FILLWINDOW
+
+/* minimum size of scrollbar before inserted buttons are
+ hidden to make room when the window is sized too small */
+#define MIN_COOLSB_SIZE 24
+
+/* min size of scrollbar when resizing a button, before the
+ resize is stopped because the scrollbar has gotten too small */
+#define MINSCROLLSIZE 50
+
+/* define this to display the default mouse arrow whenever the
+ the mouse is released over a button which has a user-defined cursor.
+ not really very useful, just provides a different type of feedback */
+#undef HIDE_CURSOR_AFTER_MOUSEUP
+
+/* enable HOT_TRACKING to provide visual feedback when the mouse
+ moves over a scrollbar area (like Flat Scrollbars) */
+#define HOT_TRACKING
+
+/* enable FLAT_SCROLLBARS to include support for flat scrollbars
+ note that they must be enabled by the user first of all */
+#define FLAT_SCROLLBARS
+
+/* a normal scrollbar "snaps" its scroll-thumb back into position if
+ you move the mouse too far away from the window, whilst you are
+ dragging the thumb, that is. #undeffing this results in the thumb
+ never snapping back into position, no matter how far away you move
+ the mouse */
+#define SNAP_THUMB_BACK
+
+/* distance (in pixels) the mouse must move away from the thumb
+ during tracking to cause the thumb bar to snap back to its
+ starting place. Has no effect unless SNAP_THUMB_BACK is defined */
+#define THUMBTRACK_SNAPDIST 24
+
+/* maximum number of inserted buttons per bar */
+#define MAX_COOLSB_BUTS 16
+
+/* maximum number of coolsb windows per application.
+ Set to lower if you don't need many. */
+#define MAX_COOLSB 4
+
+#endif /* _USERDEFINES_INCLUDED */
\ No newline at end of file |